94414-19-4
Chemical Structure
23-Hydroxyursolic acid
- CAS No.: 94414-19-4
- Formula:C30H48O4
- Molecular Weight:472.70
InChIKey: NZCULBURCGAPSF-PQWKYGPVSA-N
SMILES: C[C@]12[C@]3(C([C@@]4([H])[C@@](CC3)(CC[C@H]([C@@H]4C)C)C(O)=O)=CC[C@]1([H])[C@@]5([C@@]([C@@](C)([C@H](CC5)O)CO)([H])CC2)C)C
Biological Activity: 23-Hydroxyursolic acid is a triterpenoid compound that can be isolated from guava (Psidium guajava) leaves. Guava-related extracts possess antibacterial, anti-diabetic, and anti-inflammatory activities, but the specific functions of 23-Hydroxyursolic acid require targeted experimental verification[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
23-Hydroxyursolic acid | 23-Hydroxyursolic acid is a triterpenoid compound that can be isolated from guava (Psidium guajava) leaves. Guava-related extracts possess antibacterial, anti-diabetic, and anti-inflammatory activities, but the specific functions of 23-Hydroxyursolic acid require targeted experimental verification. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||