944251-24-5
Chemical Structure
N3-PEG4-C2-NHS ester
- CAS No.: 944251-24-5
- Formula:C15H24N4O8
- Molecular Weight:388.37
IUPAC Name: 2,5-dioxopyrrolidin-1-yl 1-azido-3,6,9,12-tetraoxapentadecan-15-oate
InChIKey: OIGKWPIMJCPGGD-UHFFFAOYSA-N
SMILES: O=C(ON1C(CCC1=O)=O)CCOCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: N3-PEG4-C2-NHS ester is a nonclaevable 4-unit PEG linker used in the synthesis of antibody-drug conjugates (ADCs). N3-PEG4-C2-NHS ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N3-PEG4-C2-NHS ester | 98.94% | N3-PEG4-C2-NHS ester is a nonclaevable 4-unit PEG linker used in the synthesis of antibody-drug conjugates (ADCs). N3-PEG4-C2-NHS ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||