96996-50-8
Chemical Structure
Cyanosafracin B
- CAS No.: 96996-50-8
- Formula:C29H35N5O6
- Molecular Weight:549.62
IUPAC Name: (S)-2-amino-N-(((6S,7R,9R,14aS,15R)-7-cyano-1-hydroxy-2,11-dimethoxy-3,12,16-trimethyl-10,13-dioxo-6,7,9,10,13,14,14a,15-octahydro-5H-6,15-epiminobenzo[4,5]azocino[1,2-b]isoquinolin-9-yl)methyl)propanamide
InChIKey: BHINEHROXMLHMV-BVRLQDJESA-N
SMILES: O=C([C@@H](N)C)NC[C@@H]1N([C@H]([C@]2([H])CC3=CC(C)=C4OC)C#N)[C@](CC(C(C(C)=C5OC)=O)=C1C5=O)([H])[C@@](N2C)([H])C3=C4O
Biological Activity: Cyanosafracin B is an Antibiotic. Cyanosafracin B is present in the fermentation products of Pseudomonas fluorescens. Cyanosafracin B can be used for the synthesis of Ecteinascidin[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cyanosafracin B | 97.53% | Cyanosafracin B is an Antibiotic. Cyanosafracin B is present in the fermentation products of Pseudomonas fluorescens. Cyanosafracin B can be used for the synthesis of Ecteinascidin. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Cyanosafracin B (Standard) | ≥98% | Cyanosafracin B (Standard) is the analytical standard of Cyanosafracin B (HY-137787). This product is intended for research and analytical applications. Cyanosafracin B is an Antibiotic. Cyanosafracin B is present in the fermentation products of Pseudomonas fluorescens. Cyanosafracin B can be used for the synthesis of Ecteinascidin. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||