977-33-3
Chemical Structure
Androstenediol 3-sulfate
- CAS No.: 977-33-3
- Formula:C19H30O5S
- Molecular Weight:370.50
InChIKey: HXJFCUUBVWOORF-LOVVWNRFSA-N
SMILES: C[C@@]12[C@]3([H])[C@](CC=C1C[C@H](CC2)OS(=O)(O)=O)([H])[C@@]4([H])[C@](CC3)([C@H](CC4)O)C
Biological Activity: Androstenediol 3-sulfate is a metabolite DHEA sulfate (HY-113416). Androstenediol 3-sulfate is a key precursor for the synthesis of androgens in the testes and plays a significant role in the self-regulatory pathway of androgen synthesis[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Androstenediol 3-sulfate | Androstenediol 3-sulfate is a metabolite DHEA sulfate (HY-113416). Androstenediol 3-sulfate is a key precursor for the synthesis of androgens in the testes and plays a significant role in the self-regulatory pathway of androgen synthesis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||