Lantadene B
Lantadene B is a triterpene component. Lantadene B can be isolated from the red variety of Lantana Camara. Lantadene B can be used in the research of cancer and inflammatory diseases.
Nos produits utilisent uniquement pour la recherche. Nous ne vendons pas aux patients.
- CAS No.: 467-82-3
- Formule: C35H52O5
- Masse moléculaire:552.78
-
Stockage:
Please store the product under the recommended conditions in the Certificate of Analysis.
Activité biologique
Description
Cellular Effect
|
Cell Line
|
Type | Value | Description | References |
|---|---|---|---|---|
| 786-0 | GI50 |
3.69 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human 786-0 cells by sulforhodamine B assay
Growth inhibition of human 786-0 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| A498 | GI50 |
1.59 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human A498 cells by sulforhodamine B assay
Growth inhibition of human A498 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| A549 | GI50 |
7.97 × 10-7M
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human A549/ATCC cells by sulforhodamine B assay
Growth inhibition of human A549/ATCC cells by sulforhodamine B assay
|
[PMID: 23644211] |
| A549 | IC50 |
1.19 μM
Compound: 2
|
Cytotoxicity against human A549 cells after 48 hrs by MTT assay
Cytotoxicity against human A549 cells after 48 hrs by MTT assay
|
[PMID: 25027934] |
| A549 | IC50 |
1.19 μmol
Compound: 2, Lantadene B
|
Cytotoxicity against human A549 cells after 48 hrs by MTT assay
Cytotoxicity against human A549 cells after 48 hrs by MTT assay
|
[PMID: 24457265] |
| A549 | IC50 |
1.56 μM
Compound: 2
|
Inhibition of TNFalpha-induced NF-kappaB activation in human A549 cells after 7 hrs by luciferase reporter gene assay
Inhibition of TNFalpha-induced NF-kappaB activation in human A549 cells after 7 hrs by luciferase reporter gene assay
|
[PMID: 25027934] |
| A549 | IC50 |
1.56 μmol
Compound: 2, Lantadene B
|
Inhibition of TNF-alpha-induced NF-kappaB (unknown origin) activation transfected in human A549 cells after 7 hrs by bright-glo luciferase reporter gene assay
Inhibition of TNF-alpha-induced NF-kappaB (unknown origin) activation transfected in human A549 cells after 7 hrs by bright-glo luciferase reporter gene assay
|
[PMID: 24457265] |
| ACHN | GI50 |
2.99 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human ACHN cells by sulforhodamine B assay
Growth inhibition of human ACHN cells by sulforhodamine B assay
|
[PMID: 23644211] |
| BT-549 | GI50 |
4.79 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human BT549 cells by sulforhodamine B assay
Growth inhibition of human BT549 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| CAKI-1 | GI50 |
3.84 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human CAKI-1 cells by sulforhodamine B assay
Growth inhibition of human CAKI-1 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| CCRF-CEM | GI50 |
2.14 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human CCRF-CEM cells by sulforhodamine B assay
Growth inhibition of human CCRF-CEM cells by sulforhodamine B assay
|
[PMID: 23644211] |
| COLO 205 | GI50 |
3.61 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human COLO205 cells by sulforhodamine B assay
Growth inhibition of human COLO205 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| DU-145 | GI50 |
5.12 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human DU145 cells by sulforhodamine B assay
Growth inhibition of human DU145 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| HCC 2998 | GI50 |
3.05 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human HCC2998 cells by sulforhodamine B assay
Growth inhibition of human HCC2998 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| HCT-116 | GI50 |
2.35 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human HCT116 cells by sulforhodamine B assay
Growth inhibition of human HCT116 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| HCT-15 | GI50 |
1.29 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human HCT15 cells by sulforhodamine B assay
Growth inhibition of human HCT15 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| HL-60(TB) | GI50 |
2.21 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human HL-60(TB) cells by sulforhodamine B assay
Growth inhibition of human HL-60(TB) cells by sulforhodamine B assay
|
[PMID: 23644211] |
| HOP-62 | GI50 |
9.26 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human HOP62 cells by sulforhodamine B assay
Growth inhibition of human HOP62 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| HOP-92 | GI50 |
1.7 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human HOP92 cells by sulforhodamine B assay
Growth inhibition of human HOP92 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| Hs-578T | GI50 |
4.16 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human Hs 578T cells by sulforhodamine B assay
Growth inhibition of human Hs 578T cells by sulforhodamine B assay
|
[PMID: 23644211] |
| HT-29 | GI50 |
3.94 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human HT-29 cells by sulforhodamine B assay
Growth inhibition of human HT-29 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| IGROV-1 | GI50 |
5.36 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human IGROV1 cells by sulforhodamine B assay
Growth inhibition of human IGROV1 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| K562 | GI50 |
3.47 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human K562 cells by sulforhodamine B assay
Growth inhibition of human K562 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| KM12 | GI50 |
8.79 × 10-7M
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human KM12 cells by sulforhodamine B assay
Growth inhibition of human KM12 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| LOX IMVI | GI50 |
6.32 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human LOXIMVI cells by sulforhodamine B assay
Growth inhibition of human LOXIMVI cells by sulforhodamine B assay
|
[PMID: 23644211] |
| M14 | GI50 |
6.52 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human M14 cells by sulforhodamine B assay
Growth inhibition of human M14 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| Malme-3M | GI50 |
1.14 × 10-5M
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human MALME-3M cells by sulforhodamine B assay
Growth inhibition of human MALME-3M cells by sulforhodamine B assay
|
[PMID: 23644211] |
| MCF7 | GI50 |
3.29 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human MCF7 cells by sulforhodamine B assay
Growth inhibition of human MCF7 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| MDA-MB-231 | GI50 |
4.03 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human MDA-MB-231 cells by sulforhodamine B assay
Growth inhibition of human MDA-MB-231 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| MDA-MB-435 | GI50 |
6.22 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human MDA-MB-435 cells by sulforhodamine B assay
Growth inhibition of human MDA-MB-435 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| MDA-MB-468 | GI50 |
2.27 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human MDA-MB-468 cells by sulforhodamine B assay
Growth inhibition of human MDA-MB-468 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| MOLT-4 | GI50 |
2.92 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human MOLT4 cells by sulforhodamine B assay
Growth inhibition of human MOLT4 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| NCI/ADR-RES | GI50 |
3.75 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human NCI-ADR-RES cells by sulforhodamine B assay
Growth inhibition of human NCI-ADR-RES cells by sulforhodamine B assay
|
[PMID: 23644211] |
| NCI-H226 | GI50 |
5.68 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human NCI-H226 cells by sulforhodamine B assay
Growth inhibition of human NCI-H226 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| NCI-H23 | GI50 |
3.96 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human NCI-H23 cells by sulforhodamine B assay
Growth inhibition of human NCI-H23 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| NCI-H322M | GI50 |
2.87 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human NCI-H322M cells by sulforhodamine B assay
Growth inhibition of human NCI-H322M cells by sulforhodamine B assay
|
[PMID: 23644211] |
| NCI-H460 | GI50 |
2.21 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human NCI-H460 cells by sulforhodamine B assay
Growth inhibition of human NCI-H460 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| NCI-H522 | GI50 |
3.14 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human NCI-H522 cells by sulforhodamine B assay
Growth inhibition of human NCI-H522 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| OVCAR-3 | GI50 |
4.08 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human OVCAR3 cells by sulforhodamine B assay
Growth inhibition of human OVCAR3 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| OVCAR-4 | GI50 |
5.07 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human OVCAR4 cells by sulforhodamine B assay
Growth inhibition of human OVCAR4 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| OVCAR-5 | GI50 |
6.53 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human OVCAR5 cells by sulforhodamine B assay
Growth inhibition of human OVCAR5 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| OVCAR-8 | GI50 |
3.81 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human OVCAR8 cells by sulforhodamine B assay
Growth inhibition of human OVCAR8 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| PC-3 | GI50 |
1.55 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human PC3 cells by sulforhodamine B assay
Growth inhibition of human PC3 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| RPMI-8226 | GI50 |
1.46 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human RPMI8226 cells by sulforhodamine B assay
Growth inhibition of human RPMI8226 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| RXF 393 | GI50 |
3.31 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human RXF393 cells by sulforhodamine B assay
Growth inhibition of human RXF393 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| SF-268 | GI50 |
5.27 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human SF268 cells by sulforhodamine B assay
Growth inhibition of human SF268 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| SF-295 | GI50 |
1.7 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human SF295 cells by sulforhodamine B assay
Growth inhibition of human SF295 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| SF-539 | GI50 |
4.75 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human SF539 cells by sulforhodamine B assay
Growth inhibition of human SF539 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| SK-MEL-2 | GI50 |
3.48 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human SK-MEL-2 cells by sulforhodamine B assay
Growth inhibition of human SK-MEL-2 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| SK-MEL-28 | GI50 |
1.16 × 10-5M
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human SK-MEL-28 cells by sulforhodamine B assay
Growth inhibition of human SK-MEL-28 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| SK-MEL-5 | GI50 |
1.5 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human SK-MEL-5 cells by sulforhodamine B assay
Growth inhibition of human SK-MEL-5 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| SK-OV-3 | GI50 |
1.66 × 10-5M
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human SKOV3 cells by sulforhodamine B assay
Growth inhibition of human SKOV3 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| SN12C | GI50 |
3.12 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human SN12C cells by sulforhodamine B assay
Growth inhibition of human SN12C cells by sulforhodamine B assay
|
[PMID: 23644211] |
| SNB-19 | GI50 |
4.25 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human SNB19 cells by sulforhodamine B assay
Growth inhibition of human SNB19 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| SNB-75 | GI50 |
7.71 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human SNB75 cells by sulforhodamine B assay
Growth inhibition of human SNB75 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| SR | GI50 |
3.75 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human SR cells by sulforhodamine B assay
Growth inhibition of human SR cells by sulforhodamine B assay
|
[PMID: 23644211] |
| SW-620 | GI50 |
4 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human SW620 cells by sulforhodamine B assay
Growth inhibition of human SW620 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| T47D | GI50 |
5.08 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human T47D cells by sulforhodamine B assay
Growth inhibition of human T47D cells by sulforhodamine B assay
|
[PMID: 23644211] |
| TK-10 | GI50 |
7.02 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human TK10 cells by sulforhodamine B assay
Growth inhibition of human TK10 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| U-251 | GI50 |
2.9 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human U251 cells by sulforhodamine B assay
Growth inhibition of human U251 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| UACC-257 | GI50 |
4.98 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human UACC257 cells by sulforhodamine B assay
Growth inhibition of human UACC257 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| UACC-62 | GI50 |
2.47 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human UACC62 cells by sulforhodamine B assay
Growth inhibition of human UACC62 cells by sulforhodamine B assay
|
[PMID: 23644211] |
| UO-31 | GI50 |
2.95 μM
Compound: 2, Lantadene B, NCS:D-764055/1,
|
Growth inhibition of human UO31 cells by sulforhodamine B assay
Growth inhibition of human UO31 cells by sulforhodamine B assay
|
[PMID: 23644211] |
Chemical Information
-
CAS No. 467-82-3
-
Masse moléculaire 552.78
-
Formule C35H52O5
-
SMILES
CC1(C(CC[C@@]2([C@]3(CC=C4[C@@]5(CC(C)(C[C@H]([C@@]5(CC[C@]4([C@@]3(CC[C@@]12[H])C)C)C(O)=O)OC(/C=C(C)/C)=O)C)[H])[H])C)=O)C
-
Structure Classification
-
Initial Source
-
Livraison
Room temperature in continental US; may vary elsewhere.
-
Stockage
Please store the product under the recommended conditions in the Certificate of Analysis.
Pureté et documentation
Références
Calculators
Concentration (start) × Volume (start) = Concentration (final) × Volume (final)