467-82-3
Chemical Structure
Lantadene B
- CAS No.: 467-82-3
- Formula:C35H52O5
- Molecular Weight:552.78
IUPAC Name: (4R,4aS,6aS,6bR,8aR,12aR,12bR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-4-((3-methylbut-2-enoyl)oxy)-10-oxo-1,3,4,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-octadecahydropicene-4a(2H)-carboxylic acid
InChIKey: VYPAPFHUHDWCBI-QQAPFUPGSA-N
SMILES: CC1(C(CC[C@@]2([C@]3(CC=C4[C@@]5(CC(C)(C[C@H]([C@@]5(CC[C@]4([C@@]3(CC[C@@]12[H])C)C)C(O)=O)OC(/C=C(C)/C)=O)C)[H])[H])C)=O)C
Biological Activity: Lantadene B is a triterpene component. Lantadene B can be isolated from the red variety of Lantana Camara. Lantadene B can be used in the research of cancer and inflammatory diseases[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Lantadene B | Lantadene B is a triterpene component. Lantadene B can be isolated from the red variety of Lantana Camara. Lantadene B can be used in the research of cancer and inflammatory diseases. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||