Lantadene B

Cat. No.: HY-122368: Data Sheet Handling Instructions
FAQs
Technical Support

Lantadene B is a triterpene component. Lantadene B can be isolated from the red variety of Lantana Camara. Lantadene B can be used in the research of cancer and inflammatory diseases.

For research use only. We do not sell to patients.

Lantadene B Chemical Structure

CAS No. : 467-82-3

Size		Stock
MOQ		Minimum order quantity
50 mg		Get quote
100 mg		Get quote
250 mg		Get quote
Other size		Get quote

* Please select Quantity before adding items.

This product is a controlled substance and not for sale in your territory.

Featured Recommendations

•Related Small Molecules:

•Related Proteins:

Biological Activity
Purity & Documentation
References
Customer Review

Description

Lantadene B is a triterpene component. Lantadene B can be isolated from the red variety of Lantana Camara. Lantadene B can be used in the research of cancer and inflammatory diseases^[1].

Cellular Effect

Cell Line	Type	Value	Description	References
786-0	GI₅₀	3.69 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human 786-0 cells by sulforhodamine B assay Growth inhibition of human 786-0 cells by sulforhodamine B assay	[PMID: 23644211]
A498	GI₅₀	1.59 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human A498 cells by sulforhodamine B assay Growth inhibition of human A498 cells by sulforhodamine B assay	[PMID: 23644211]
A549	GI₅₀	7.97 × 10^-7M Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human A549/ATCC cells by sulforhodamine B assay Growth inhibition of human A549/ATCC cells by sulforhodamine B assay	[PMID: 23644211]
A549	IC₅₀	1.19 μM Compound: 2	Cytotoxicity against human A549 cells after 48 hrs by MTT assay Cytotoxicity against human A549 cells after 48 hrs by MTT assay	[PMID: 25027934]
A549	IC₅₀	1.19 μmol Compound: 2, Lantadene B	Cytotoxicity against human A549 cells after 48 hrs by MTT assay Cytotoxicity against human A549 cells after 48 hrs by MTT assay	[PMID: 24457265]
A549	IC₅₀	1.56 μM Compound: 2	Inhibition of TNFalpha-induced NF-kappaB activation in human A549 cells after 7 hrs by luciferase reporter gene assay Inhibition of TNFalpha-induced NF-kappaB activation in human A549 cells after 7 hrs by luciferase reporter gene assay	[PMID: 25027934]
A549	IC₅₀	1.56 μmol Compound: 2, Lantadene B	Inhibition of TNF-alpha-induced NF-kappaB (unknown origin) activation transfected in human A549 cells after 7 hrs by bright-glo luciferase reporter gene assay Inhibition of TNF-alpha-induced NF-kappaB (unknown origin) activation transfected in human A549 cells after 7 hrs by bright-glo luciferase reporter gene assay	[PMID: 24457265]
ACHN	GI₅₀	2.99 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human ACHN cells by sulforhodamine B assay Growth inhibition of human ACHN cells by sulforhodamine B assay	[PMID: 23644211]
BT-549	GI₅₀	4.79 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human BT549 cells by sulforhodamine B assay Growth inhibition of human BT549 cells by sulforhodamine B assay	[PMID: 23644211]
CAKI-1	GI₅₀	3.84 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human CAKI-1 cells by sulforhodamine B assay Growth inhibition of human CAKI-1 cells by sulforhodamine B assay	[PMID: 23644211]
CCRF-CEM	GI₅₀	2.14 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human CCRF-CEM cells by sulforhodamine B assay Growth inhibition of human CCRF-CEM cells by sulforhodamine B assay	[PMID: 23644211]
COLO 205	GI₅₀	3.61 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human COLO205 cells by sulforhodamine B assay Growth inhibition of human COLO205 cells by sulforhodamine B assay	[PMID: 23644211]
DU-145	GI₅₀	5.12 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human DU145 cells by sulforhodamine B assay Growth inhibition of human DU145 cells by sulforhodamine B assay	[PMID: 23644211]
HCC 2998	GI₅₀	3.05 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human HCC2998 cells by sulforhodamine B assay Growth inhibition of human HCC2998 cells by sulforhodamine B assay	[PMID: 23644211]
HCT-116	GI₅₀	2.35 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human HCT116 cells by sulforhodamine B assay Growth inhibition of human HCT116 cells by sulforhodamine B assay	[PMID: 23644211]
HCT-15	GI₅₀	1.29 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human HCT15 cells by sulforhodamine B assay Growth inhibition of human HCT15 cells by sulforhodamine B assay	[PMID: 23644211]
HL-60(TB)	GI₅₀	2.21 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human HL-60(TB) cells by sulforhodamine B assay Growth inhibition of human HL-60(TB) cells by sulforhodamine B assay	[PMID: 23644211]
HOP-62	GI₅₀	9.26 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human HOP62 cells by sulforhodamine B assay Growth inhibition of human HOP62 cells by sulforhodamine B assay	[PMID: 23644211]
HOP-92	GI₅₀	1.7 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human HOP92 cells by sulforhodamine B assay Growth inhibition of human HOP92 cells by sulforhodamine B assay	[PMID: 23644211]
Hs-578T	GI₅₀	4.16 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human Hs 578T cells by sulforhodamine B assay Growth inhibition of human Hs 578T cells by sulforhodamine B assay	[PMID: 23644211]
HT-29	GI₅₀	3.94 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human HT-29 cells by sulforhodamine B assay Growth inhibition of human HT-29 cells by sulforhodamine B assay	[PMID: 23644211]
IGROV-1	GI₅₀	5.36 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human IGROV1 cells by sulforhodamine B assay Growth inhibition of human IGROV1 cells by sulforhodamine B assay	[PMID: 23644211]
K562	GI₅₀	3.47 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human K562 cells by sulforhodamine B assay Growth inhibition of human K562 cells by sulforhodamine B assay	[PMID: 23644211]
KM12	GI₅₀	8.79 × 10^-7M Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human KM12 cells by sulforhodamine B assay Growth inhibition of human KM12 cells by sulforhodamine B assay	[PMID: 23644211]
LOX IMVI	GI₅₀	6.32 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human LOXIMVI cells by sulforhodamine B assay Growth inhibition of human LOXIMVI cells by sulforhodamine B assay	[PMID: 23644211]
M14	GI₅₀	6.52 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human M14 cells by sulforhodamine B assay Growth inhibition of human M14 cells by sulforhodamine B assay	[PMID: 23644211]
Malme-3M	GI₅₀	1.14 × 10^-5M Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human MALME-3M cells by sulforhodamine B assay Growth inhibition of human MALME-3M cells by sulforhodamine B assay	[PMID: 23644211]
MCF7	GI₅₀	3.29 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human MCF7 cells by sulforhodamine B assay Growth inhibition of human MCF7 cells by sulforhodamine B assay	[PMID: 23644211]
MDA-MB-231	GI₅₀	4.03 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human MDA-MB-231 cells by sulforhodamine B assay Growth inhibition of human MDA-MB-231 cells by sulforhodamine B assay	[PMID: 23644211]
MDA-MB-435	GI₅₀	6.22 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human MDA-MB-435 cells by sulforhodamine B assay Growth inhibition of human MDA-MB-435 cells by sulforhodamine B assay	[PMID: 23644211]
MDA-MB-468	GI₅₀	2.27 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human MDA-MB-468 cells by sulforhodamine B assay Growth inhibition of human MDA-MB-468 cells by sulforhodamine B assay	[PMID: 23644211]
MOLT-4	GI₅₀	2.92 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human MOLT4 cells by sulforhodamine B assay Growth inhibition of human MOLT4 cells by sulforhodamine B assay	[PMID: 23644211]
NCI/ADR-RES	GI₅₀	3.75 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human NCI-ADR-RES cells by sulforhodamine B assay Growth inhibition of human NCI-ADR-RES cells by sulforhodamine B assay	[PMID: 23644211]
NCI-H226	GI₅₀	5.68 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human NCI-H226 cells by sulforhodamine B assay Growth inhibition of human NCI-H226 cells by sulforhodamine B assay	[PMID: 23644211]
NCI-H23	GI₅₀	3.96 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human NCI-H23 cells by sulforhodamine B assay Growth inhibition of human NCI-H23 cells by sulforhodamine B assay	[PMID: 23644211]
NCI-H322M	GI₅₀	2.87 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human NCI-H322M cells by sulforhodamine B assay Growth inhibition of human NCI-H322M cells by sulforhodamine B assay	[PMID: 23644211]
NCI-H460	GI₅₀	2.21 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human NCI-H460 cells by sulforhodamine B assay Growth inhibition of human NCI-H460 cells by sulforhodamine B assay	[PMID: 23644211]
NCI-H522	GI₅₀	3.14 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human NCI-H522 cells by sulforhodamine B assay Growth inhibition of human NCI-H522 cells by sulforhodamine B assay	[PMID: 23644211]
OVCAR-3	GI₅₀	4.08 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human OVCAR3 cells by sulforhodamine B assay Growth inhibition of human OVCAR3 cells by sulforhodamine B assay	[PMID: 23644211]
OVCAR-4	GI₅₀	5.07 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human OVCAR4 cells by sulforhodamine B assay Growth inhibition of human OVCAR4 cells by sulforhodamine B assay	[PMID: 23644211]
OVCAR-5	GI₅₀	6.53 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human OVCAR5 cells by sulforhodamine B assay Growth inhibition of human OVCAR5 cells by sulforhodamine B assay	[PMID: 23644211]
OVCAR-8	GI₅₀	3.81 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human OVCAR8 cells by sulforhodamine B assay Growth inhibition of human OVCAR8 cells by sulforhodamine B assay	[PMID: 23644211]
PC-3	GI₅₀	1.55 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human PC3 cells by sulforhodamine B assay Growth inhibition of human PC3 cells by sulforhodamine B assay	[PMID: 23644211]
RPMI-8226	GI₅₀	1.46 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human RPMI8226 cells by sulforhodamine B assay Growth inhibition of human RPMI8226 cells by sulforhodamine B assay	[PMID: 23644211]
RXF 393	GI₅₀	3.31 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human RXF393 cells by sulforhodamine B assay Growth inhibition of human RXF393 cells by sulforhodamine B assay	[PMID: 23644211]
SF-268	GI₅₀	5.27 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human SF268 cells by sulforhodamine B assay Growth inhibition of human SF268 cells by sulforhodamine B assay	[PMID: 23644211]
SF-295	GI₅₀	1.7 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human SF295 cells by sulforhodamine B assay Growth inhibition of human SF295 cells by sulforhodamine B assay	[PMID: 23644211]
SF-539	GI₅₀	4.75 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human SF539 cells by sulforhodamine B assay Growth inhibition of human SF539 cells by sulforhodamine B assay	[PMID: 23644211]
SK-MEL-2	GI₅₀	3.48 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human SK-MEL-2 cells by sulforhodamine B assay Growth inhibition of human SK-MEL-2 cells by sulforhodamine B assay	[PMID: 23644211]
SK-MEL-28	GI₅₀	1.16 × 10^-5M Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human SK-MEL-28 cells by sulforhodamine B assay Growth inhibition of human SK-MEL-28 cells by sulforhodamine B assay	[PMID: 23644211]
SK-MEL-5	GI₅₀	1.5 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human SK-MEL-5 cells by sulforhodamine B assay Growth inhibition of human SK-MEL-5 cells by sulforhodamine B assay	[PMID: 23644211]
SK-OV-3	GI₅₀	1.66 × 10^-5M Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human SKOV3 cells by sulforhodamine B assay Growth inhibition of human SKOV3 cells by sulforhodamine B assay	[PMID: 23644211]
SN12C	GI₅₀	3.12 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human SN12C cells by sulforhodamine B assay Growth inhibition of human SN12C cells by sulforhodamine B assay	[PMID: 23644211]
SNB-19	GI₅₀	4.25 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human SNB19 cells by sulforhodamine B assay Growth inhibition of human SNB19 cells by sulforhodamine B assay	[PMID: 23644211]
SNB-75	GI₅₀	7.71 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human SNB75 cells by sulforhodamine B assay Growth inhibition of human SNB75 cells by sulforhodamine B assay	[PMID: 23644211]
SR	GI₅₀	3.75 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human SR cells by sulforhodamine B assay Growth inhibition of human SR cells by sulforhodamine B assay	[PMID: 23644211]
SW-620	GI₅₀	4 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human SW620 cells by sulforhodamine B assay Growth inhibition of human SW620 cells by sulforhodamine B assay	[PMID: 23644211]
T47D	GI₅₀	5.08 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human T47D cells by sulforhodamine B assay Growth inhibition of human T47D cells by sulforhodamine B assay	[PMID: 23644211]
TK-10	GI₅₀	7.02 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human TK10 cells by sulforhodamine B assay Growth inhibition of human TK10 cells by sulforhodamine B assay	[PMID: 23644211]
U-251	GI₅₀	2.9 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human U251 cells by sulforhodamine B assay Growth inhibition of human U251 cells by sulforhodamine B assay	[PMID: 23644211]
UACC-257	GI₅₀	4.98 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human UACC257 cells by sulforhodamine B assay Growth inhibition of human UACC257 cells by sulforhodamine B assay	[PMID: 23644211]
UACC-62	GI₅₀	2.47 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human UACC62 cells by sulforhodamine B assay Growth inhibition of human UACC62 cells by sulforhodamine B assay	[PMID: 23644211]
UO-31	GI₅₀	2.95 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human UO31 cells by sulforhodamine B assay Growth inhibition of human UO31 cells by sulforhodamine B assay	[PMID: 23644211]

Molecular Weight

552.78

Formula

C₃₅H₅₂O₅

CAS No.

467-82-3

SMILES

CC1(C(CC[C@@]2([C@]3(CC=C4[C@@]5(CC(C)(C[C@H]([C@@]5(CC[C@]4([C@@]3(CC[C@@]12[H])C)C)C(O)=O)OC(/C=C(C)/C)=O)C)[H])[H])C)=O)C

Structure Classification

Initial Source

Shipping

Room temperature in continental US; may vary elsewhere.

Storage

Please store the product under the recommended conditions in the Certificate of Analysis.

Purity & Documentation

Handling Instructions (2659 KB)

References

[1]. Turner J G, et al. Effects of tabtoxin on nitrogen metabolism[J]. Physiologia Plantarum, 1986, 67(4): 649-653.

Lantadene B Related Classifications

Molarity Calculator
Dilution Calculator

The molarity calculator equation

Mass (g) = Concentration (mol/L) × Volume (L) × Molecular Weight (g/mol)

Mass		Concentration		Volume		Molecular Weight *
	=		×		×

The dilution calculator equation

Concentration _(start) × Volume _(start) = Concentration _(final) × Volume _(final)

This equation is commonly abbreviated as: C₁V₁ = C₂V₂

Concentration _(start)	×	Volume _(start)	=	Concentration _(final)	×	Volume _(final)
	×		=		×
C1		V1		C2		V2

Help & FAQs

Do most proteins show cross-species activity?
Species cross-reactivity must be investigated individually for each product. Many human cytokines will produce a nice response in mouse cell lines, and many mouse proteins will show activity on human cells. Other proteins may have a lower specific activity when used in the opposite species.

Keywords:

Lantadene B467-82-3OthersLantana CamaraInhibitorinhibitorinhibit

Your Recently Viewed Products:

Product Name

Requested Quantity *

Applicant Name *

Salutation

Email Address *

Phone Number *

Department

Organization Name *

City

State

Country or Region *

Remarks

Product Name

Lot #

Applicant Name *

Email Address *

Phone Number

Department *

Organization Name *

Country or Region *

Remarks

Name
Email *

	Sorry, but the email address you supplied was invalid.

Lantadene B

Lantadene B Related Antibodies

Featured Recommendations

•Related Small Molecules:

•Related Proteins:

Biological Activity

Purity & Documentation

References

Customer Review

Lantadene B Related Classifications

Molarity Calculator

Dilution Calculator