Cat. No.: HY-122368

Lantadene B

Lantadene B is a triterpene component. Lantadene B can be isolated from the red variety of Lantana Camara. Lantadene B can be used in the research of cancer and inflammatory diseases.

For research use only. We do not sell to patients.

CAS No.: 467-82-3
Formula: C₃₅H₅₂O₅
Molecular Weight:552.78

Storage:

Please store the product under the recommended conditions in the Certificate of Analysis.

Data Sheet (266 KB)

Lantadene B Chemical Structure

CAS No.: 467-82-3

Size

Price

Stock

Quantity

Amount: USD 0.00

* Please select Quantity before adding items.

Top Publications Citing

Use of MCE Products

Fluorescent Dye

Strong Fluorescence Signal / Multi-Disciplinary Applications / High Fluorescence Specificity

Biological Activity
- Description
- Cellular Effect
Chemical Information
Purity & Documentation
References
Calculators
Help & FAQs
Classifications
Bioz

Biological Activity

Description

Lantadene B is a triterpene component. Lantadene B can be isolated from the red variety of Lantana Camara. Lantadene B can be used in the research of cancer and inflammatory diseases^[1].

Cellular Effect

Cell Line	Type	Value	Description	References
786-0	GI₅₀	3.69 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human 786-0 cells by sulforhodamine B assay Growth inhibition of human 786-0 cells by sulforhodamine B assay	[PMID: 23644211]
A498	GI₅₀	1.59 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human A498 cells by sulforhodamine B assay Growth inhibition of human A498 cells by sulforhodamine B assay	[PMID: 23644211]
A549	GI₅₀	7.97 × 10^-7M Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human A549/ATCC cells by sulforhodamine B assay Growth inhibition of human A549/ATCC cells by sulforhodamine B assay	[PMID: 23644211]
A549	IC₅₀	1.19 μM Compound: 2	Cytotoxicity against human A549 cells after 48 hrs by MTT assay Cytotoxicity against human A549 cells after 48 hrs by MTT assay	[PMID: 25027934]
A549	IC₅₀	1.19 μmol Compound: 2, Lantadene B	Cytotoxicity against human A549 cells after 48 hrs by MTT assay Cytotoxicity against human A549 cells after 48 hrs by MTT assay	[PMID: 24457265]
A549	IC₅₀	1.56 μM Compound: 2	Inhibition of TNFalpha-induced NF-kappaB activation in human A549 cells after 7 hrs by luciferase reporter gene assay Inhibition of TNFalpha-induced NF-kappaB activation in human A549 cells after 7 hrs by luciferase reporter gene assay	[PMID: 25027934]
A549	IC₅₀	1.56 μmol Compound: 2, Lantadene B	Inhibition of TNF-alpha-induced NF-kappaB (unknown origin) activation transfected in human A549 cells after 7 hrs by bright-glo luciferase reporter gene assay Inhibition of TNF-alpha-induced NF-kappaB (unknown origin) activation transfected in human A549 cells after 7 hrs by bright-glo luciferase reporter gene assay	[PMID: 24457265]
ACHN	GI₅₀	2.99 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human ACHN cells by sulforhodamine B assay Growth inhibition of human ACHN cells by sulforhodamine B assay	[PMID: 23644211]
BT-549	GI₅₀	4.79 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human BT549 cells by sulforhodamine B assay Growth inhibition of human BT549 cells by sulforhodamine B assay	[PMID: 23644211]
CAKI-1	GI₅₀	3.84 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human CAKI-1 cells by sulforhodamine B assay Growth inhibition of human CAKI-1 cells by sulforhodamine B assay	[PMID: 23644211]
CCRF-CEM	GI₅₀	2.14 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human CCRF-CEM cells by sulforhodamine B assay Growth inhibition of human CCRF-CEM cells by sulforhodamine B assay	[PMID: 23644211]
COLO 205	GI₅₀	3.61 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human COLO205 cells by sulforhodamine B assay Growth inhibition of human COLO205 cells by sulforhodamine B assay	[PMID: 23644211]
DU-145	GI₅₀	5.12 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human DU145 cells by sulforhodamine B assay Growth inhibition of human DU145 cells by sulforhodamine B assay	[PMID: 23644211]
HCC 2998	GI₅₀	3.05 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human HCC2998 cells by sulforhodamine B assay Growth inhibition of human HCC2998 cells by sulforhodamine B assay	[PMID: 23644211]
HCT-116	GI₅₀	2.35 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human HCT116 cells by sulforhodamine B assay Growth inhibition of human HCT116 cells by sulforhodamine B assay	[PMID: 23644211]
HCT-15	GI₅₀	1.29 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human HCT15 cells by sulforhodamine B assay Growth inhibition of human HCT15 cells by sulforhodamine B assay	[PMID: 23644211]
HL-60(TB)	GI₅₀	2.21 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human HL-60(TB) cells by sulforhodamine B assay Growth inhibition of human HL-60(TB) cells by sulforhodamine B assay	[PMID: 23644211]
HOP-62	GI₅₀	9.26 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human HOP62 cells by sulforhodamine B assay Growth inhibition of human HOP62 cells by sulforhodamine B assay	[PMID: 23644211]
HOP-92	GI₅₀	1.7 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human HOP92 cells by sulforhodamine B assay Growth inhibition of human HOP92 cells by sulforhodamine B assay	[PMID: 23644211]
Hs-578T	GI₅₀	4.16 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human Hs 578T cells by sulforhodamine B assay Growth inhibition of human Hs 578T cells by sulforhodamine B assay	[PMID: 23644211]
HT-29	GI₅₀	3.94 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human HT-29 cells by sulforhodamine B assay Growth inhibition of human HT-29 cells by sulforhodamine B assay	[PMID: 23644211]
IGROV-1	GI₅₀	5.36 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human IGROV1 cells by sulforhodamine B assay Growth inhibition of human IGROV1 cells by sulforhodamine B assay	[PMID: 23644211]
K562	GI₅₀	3.47 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human K562 cells by sulforhodamine B assay Growth inhibition of human K562 cells by sulforhodamine B assay	[PMID: 23644211]
KM12	GI₅₀	8.79 × 10^-7M Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human KM12 cells by sulforhodamine B assay Growth inhibition of human KM12 cells by sulforhodamine B assay	[PMID: 23644211]
LOX IMVI	GI₅₀	6.32 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human LOXIMVI cells by sulforhodamine B assay Growth inhibition of human LOXIMVI cells by sulforhodamine B assay	[PMID: 23644211]
M14	GI₅₀	6.52 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human M14 cells by sulforhodamine B assay Growth inhibition of human M14 cells by sulforhodamine B assay	[PMID: 23644211]
Malme-3M	GI₅₀	1.14 × 10^-5M Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human MALME-3M cells by sulforhodamine B assay Growth inhibition of human MALME-3M cells by sulforhodamine B assay	[PMID: 23644211]
MCF7	GI₅₀	3.29 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human MCF7 cells by sulforhodamine B assay Growth inhibition of human MCF7 cells by sulforhodamine B assay	[PMID: 23644211]
MDA-MB-231	GI₅₀	4.03 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human MDA-MB-231 cells by sulforhodamine B assay Growth inhibition of human MDA-MB-231 cells by sulforhodamine B assay	[PMID: 23644211]
MDA-MB-435	GI₅₀	6.22 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human MDA-MB-435 cells by sulforhodamine B assay Growth inhibition of human MDA-MB-435 cells by sulforhodamine B assay	[PMID: 23644211]
MDA-MB-468	GI₅₀	2.27 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human MDA-MB-468 cells by sulforhodamine B assay Growth inhibition of human MDA-MB-468 cells by sulforhodamine B assay	[PMID: 23644211]
MOLT-4	GI₅₀	2.92 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human MOLT4 cells by sulforhodamine B assay Growth inhibition of human MOLT4 cells by sulforhodamine B assay	[PMID: 23644211]
NCI/ADR-RES	GI₅₀	3.75 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human NCI-ADR-RES cells by sulforhodamine B assay Growth inhibition of human NCI-ADR-RES cells by sulforhodamine B assay	[PMID: 23644211]
NCI-H226	GI₅₀	5.68 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human NCI-H226 cells by sulforhodamine B assay Growth inhibition of human NCI-H226 cells by sulforhodamine B assay	[PMID: 23644211]
NCI-H23	GI₅₀	3.96 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human NCI-H23 cells by sulforhodamine B assay Growth inhibition of human NCI-H23 cells by sulforhodamine B assay	[PMID: 23644211]
NCI-H322M	GI₅₀	2.87 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human NCI-H322M cells by sulforhodamine B assay Growth inhibition of human NCI-H322M cells by sulforhodamine B assay	[PMID: 23644211]
NCI-H460	GI₅₀	2.21 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human NCI-H460 cells by sulforhodamine B assay Growth inhibition of human NCI-H460 cells by sulforhodamine B assay	[PMID: 23644211]
NCI-H522	GI₅₀	3.14 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human NCI-H522 cells by sulforhodamine B assay Growth inhibition of human NCI-H522 cells by sulforhodamine B assay	[PMID: 23644211]
OVCAR-3	GI₅₀	4.08 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human OVCAR3 cells by sulforhodamine B assay Growth inhibition of human OVCAR3 cells by sulforhodamine B assay	[PMID: 23644211]
OVCAR-4	GI₅₀	5.07 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human OVCAR4 cells by sulforhodamine B assay Growth inhibition of human OVCAR4 cells by sulforhodamine B assay	[PMID: 23644211]
OVCAR-5	GI₅₀	6.53 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human OVCAR5 cells by sulforhodamine B assay Growth inhibition of human OVCAR5 cells by sulforhodamine B assay	[PMID: 23644211]
OVCAR-8	GI₅₀	3.81 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human OVCAR8 cells by sulforhodamine B assay Growth inhibition of human OVCAR8 cells by sulforhodamine B assay	[PMID: 23644211]
PC-3	GI₅₀	1.55 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human PC3 cells by sulforhodamine B assay Growth inhibition of human PC3 cells by sulforhodamine B assay	[PMID: 23644211]
RPMI-8226	GI₅₀	1.46 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human RPMI8226 cells by sulforhodamine B assay Growth inhibition of human RPMI8226 cells by sulforhodamine B assay	[PMID: 23644211]
RXF 393	GI₅₀	3.31 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human RXF393 cells by sulforhodamine B assay Growth inhibition of human RXF393 cells by sulforhodamine B assay	[PMID: 23644211]
SF-268	GI₅₀	5.27 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human SF268 cells by sulforhodamine B assay Growth inhibition of human SF268 cells by sulforhodamine B assay	[PMID: 23644211]
SF-295	GI₅₀	1.7 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human SF295 cells by sulforhodamine B assay Growth inhibition of human SF295 cells by sulforhodamine B assay	[PMID: 23644211]
SF-539	GI₅₀	4.75 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human SF539 cells by sulforhodamine B assay Growth inhibition of human SF539 cells by sulforhodamine B assay	[PMID: 23644211]
SK-MEL-2	GI₅₀	3.48 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human SK-MEL-2 cells by sulforhodamine B assay Growth inhibition of human SK-MEL-2 cells by sulforhodamine B assay	[PMID: 23644211]
SK-MEL-28	GI₅₀	1.16 × 10^-5M Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human SK-MEL-28 cells by sulforhodamine B assay Growth inhibition of human SK-MEL-28 cells by sulforhodamine B assay	[PMID: 23644211]
SK-MEL-5	GI₅₀	1.5 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human SK-MEL-5 cells by sulforhodamine B assay Growth inhibition of human SK-MEL-5 cells by sulforhodamine B assay	[PMID: 23644211]
SK-OV-3	GI₅₀	1.66 × 10^-5M Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human SKOV3 cells by sulforhodamine B assay Growth inhibition of human SKOV3 cells by sulforhodamine B assay	[PMID: 23644211]
SN12C	GI₅₀	3.12 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human SN12C cells by sulforhodamine B assay Growth inhibition of human SN12C cells by sulforhodamine B assay	[PMID: 23644211]
SNB-19	GI₅₀	4.25 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human SNB19 cells by sulforhodamine B assay Growth inhibition of human SNB19 cells by sulforhodamine B assay	[PMID: 23644211]
SNB-75	GI₅₀	7.71 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human SNB75 cells by sulforhodamine B assay Growth inhibition of human SNB75 cells by sulforhodamine B assay	[PMID: 23644211]
SR	GI₅₀	3.75 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human SR cells by sulforhodamine B assay Growth inhibition of human SR cells by sulforhodamine B assay	[PMID: 23644211]
SW-620	GI₅₀	4 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human SW620 cells by sulforhodamine B assay Growth inhibition of human SW620 cells by sulforhodamine B assay	[PMID: 23644211]
T47D	GI₅₀	5.08 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human T47D cells by sulforhodamine B assay Growth inhibition of human T47D cells by sulforhodamine B assay	[PMID: 23644211]
TK-10	GI₅₀	7.02 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human TK10 cells by sulforhodamine B assay Growth inhibition of human TK10 cells by sulforhodamine B assay	[PMID: 23644211]
U-251	GI₅₀	2.9 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human U251 cells by sulforhodamine B assay Growth inhibition of human U251 cells by sulforhodamine B assay	[PMID: 23644211]
UACC-257	GI₅₀	4.98 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human UACC257 cells by sulforhodamine B assay Growth inhibition of human UACC257 cells by sulforhodamine B assay	[PMID: 23644211]
UACC-62	GI₅₀	2.47 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human UACC62 cells by sulforhodamine B assay Growth inhibition of human UACC62 cells by sulforhodamine B assay	[PMID: 23644211]
UO-31	GI₅₀	2.95 μM Compound: 2, Lantadene B, NCS:D-764055/1,	Growth inhibition of human UO31 cells by sulforhodamine B assay Growth inhibition of human UO31 cells by sulforhodamine B assay	[PMID: 23644211]

Chemical Information

CAS No. 467-82-3
Molecular Weight 552.78
Formula C₃₅H₅₂O₅
SMILES

CC1(C(CC[C@@]2([C@]3(CC=C4[C@@]5(CC(C)(C[C@H]([C@@]5(CC[C@]4([C@@]3(CC[C@@]12[H])C)C)C(O)=O)OC(/C=C(C)/C)=O)C)[H])[H])C)=O)C
Structure Classification
- Terpenoids
- Triterpenes
Initial Source
Shipping

Room temperature in continental US; may vary elsewhere.
Storage

Please store the product under the recommended conditions in the Certificate of Analysis.

Purity & Documentation

Select Batch:

Purity: 99.98%

Assay: 99.98%

ee.: 99.98%

Data Sheet (266 KB)
COA (2659 KB)
Elemental Analysis Report (2659 KB)
HNMR (2659 KB)
CNMR (2659 KB)
RP-HPLC (2659 KB)
NP-HPLC (2659 KB)
MS (2659 KB)
LCMS (2659 KB)
IR (2659 KB)
GC (2659 KB)
OR (2659 KB)
SDS-PAGE (2659 KB)
SEC-HPLC (2659 KB)
Other Report (2659 KB)
Handling Instructions (2659 KB)

References

[1]. Turner J G, et al. Effects of tabtoxin on nitrogen metabolism[J]. Physiologia Plantarum, 1986, 67(4): 649-653.

Calculators

Molarity Calculator

Mass (g) = Concentration (mol/L) × Volume (L) × Molecular Weight (g/mol)

Mass Mass

Concentration Concentration

Volume Volume

Molecular Weight Molecular Weight

Dilution Calculator

Concentration _(start) × Volume _(start) = Concentration _(final) × Volume _(final)

Concentration _(start) Concentration _(start)

Volume _(start) Volume _(start)

Concentration _(final) Concentration _(final)

Volume _(final) Volume _(final)

Help & FAQs

How should lyophilized recombinant proteins be reconstituted and stored?

1. Before opening the cap, centrifuge the vial at 13000 rpm for 20-30 seconds. This step will ensure that any lyophilized powder that may have adhered to the cap or walls is collected at the bottom of the vial, minimizing the risk of product loss.

Keywords

Product Name:
Cat. No.:
Quantity:
MCE Japan Authorized Agent:

Product Name:
CAS No.:
Species:
Purity:
Quantity: