1020210-12-1
Chemical Structure
Meayamycin B
Synonym(s): (+)-Meayamycin B
- CAS No.: 1020210-12-1
- Formula:C31H48N2O8
- Molecular Weight:576.72
IUPAC Name: (S,Z)-5-(((2R,3R,5S,6S)-6-((2E,4E)-5-((3R,4R,5R)-4-hydroxy-7,7-dimethyl-1,6-dioxaspiro[2.5]octan-5-yl)-3-methylpenta-2,4-dien-1-yl)-2,5-dimethyltetrahydro-2H-pyran-3-yl)amino)-5-oxopent-3-en-2-yl morpholine-4-carboxylate
InChIKey: LWHSGUXHAJKMME-YXWNKITCSA-N
SMILES: O[C@H]1[C@@]2(CC(C)(O[C@@H]1/C=C/C(C)=C/C[C@H]3[C@H](C[C@H]([C@H](O3)C)NC(/C=C\[C@H](C)OC(N4CCOCC4)=O)=O)C)C)CO2
Biological Activity: Meayamycin B ((+)-Meayamycin B) is a potent SF3B1 inhibitor. Meayamycin B upregulates the proapoptotic Mcl-1S and downregulates Mcl-1L at the pre-mRNA splicing level. Meayamycin B does not regulate the alternative splicing of Bcl-x. Meayamycin B and ABT-737 (HY-50907) synergistically causes Apoptosis. Meayamycin B exhibits anticancer activity against non-small cell lung cancer[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Meayamycin B | Meayamycin B ((+)-Meayamycin B) is a potent SF3B1 inhibitor. Meayamycin B upregulates the proapoptotic Mcl-1S and downregulates Mcl-1L at the pre-mRNA splicing level. Meayamycin B does not regulate the alternative splicing of Bcl-x. Meayamycin B and ABT-737 (HY-50907) synergistically causes Apoptosis. Meayamycin B exhibits anticancer activity against non-small cell lung cancer. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
