113942-30-6
Chemical Structure
Temozolomide acid
- CAS No.: 113942-30-6
- Formula:C6H5N5O3
- Molecular Weight:195.14
IUPAC Name: 3-methyl-4-oxo-3,4-dihydroimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxylic acid
InChIKey: VVTMIOYTNALQAW-UHFFFAOYSA-N
SMILES: CN1N=NC2=C(N=CN2C1=O)C(O)=O
Biological Activity: Temozolomide acid is a carboxylic acid derivative of Temozolomide (HY-17364) with anticancer activity. Temozolomide is a DNA alkylating agent, methylating the guanine and adenine bases of DNA, causing breaks in DNA double strand, cell cycle arrest, and eventually cell death. Temozolomide acid is promising for research of glioblastoma and brain cancer[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Temozolomide acid | 99.81% | Temozolomide acid is a carboxylic acid derivative of Temozolomide (HY-17364) with anticancer activity. Temozolomide is a DNA alkylating agent, methylating the guanine and adenine bases of DNA, causing breaks in DNA double strand, cell cycle arrest, and eventually cell death. Temozolomide acid is promising for research of glioblastoma and brain cancer. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||