114420-67-6
Chemical Structure
Regaloside B
- CAS No.: 114420-67-6
- Formula:C20H26O11
- Molecular Weight:442.41
IUPAC Name: (S)-3-acetoxy-2-(((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)propyl (E)-3-(4-hydroxyphenyl)acrylate
InChIKey: YQKQOLPNKNHLBO-DVAIZSLESA-N
SMILES: O[C@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)[C@@H]1O[C@H](COC(/C=C/C2=CC=C(O)C=C2)=O)COC(C)=O
Biological Activity: Regaloside B is a phenylpropane. Regaloside B can be isolated from Lilium longiflorum. Regaloside B can inhibit the expression of VCAM-1, iNOS, and COX-2, with a p-p65/p-65 ratio. Regaloside B inhibits the mRNA of various chemokines and angiogenic factors (CXCL9, CXCL10, IL8, IDO). Regaloside B has anti-inflammatory activity. Regaloside B can be used for osteogenic differentiation research[1][2][3].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Regaloside B | 99.90% | Regaloside B is a phenylpropane. Regaloside B can be isolated from Lilium longiflorum. Regaloside B can inhibit the expression of VCAM-1, iNOS, and COX-2, with a p-p65/p-65 ratio. Regaloside B inhibits the mRNA of various chemokines and angiogenic factors (CXCL9, CXCL10, IL8, IDO). Regaloside B has anti-inflammatory activity. Regaloside B can be used for osteogenic differentiation research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
- [1]. Thi NN, et, al. Phenylpropanoids from Lilium Asiatic hybrid flowers and their anti-inflammatory activities. Applied Biological Chemistry. 2017; 60: 527–533.
- [2]. Kim BR, et, al. Purification of Phenylpropanoids from the Scaly Bulbs of Lilium Longiflorum by CPC and Determination of Their DPP-IV Inhibitory Potentials. ACS Omega. 2020 Feb 20; 5(8): 4050-4057. [Content Brief]
- [3]. Chen G, et al. Total Glycosides and Regaloside B from Lily: Potential Therapeutic Agents for Osteogenic Differentiation, Migration, and Angiogenesis. ACS Omega. 2025 Jul 20;10(29):31638-31648. [Content Brief]
Keywords
