114580-45-9
Chemical Structure
FK 973
- CAS No.: 114580-45-9
- Formula:C20H21N3O9
- Molecular Weight:447.40
IUPAC Name: (1aS,3S,8R,9S,9aS)-1-acetyl-8-((carbamoyloxy)methyl)-5-formyl-1,1a,2,9a-tetrahydro-3,9-epoxyazirino[2,3-f]benzo[b]azocine-7,9(8H)-diyl diacetate
InChIKey: FBXPCVIKIBWXAE-ZJZHAWLTSA-N
SMILES: CC(O[C@]12[C@@H]3[C@H](C[N@@](C4=CC(C=O)=CC(OC(C)=O)=C4[C@@H]2COC(N)=O)O1)N3C(C)=O)=O
Biological Activity: FK 973 is a dihydrobenzoxazine anticancer agent. FK 973 selectively inhibits DNA synthesis and can form DNA cross-links through cytoplasmic activation. FK 973 exhibits significant antitumor activity in various animal tumor models and human tumor xenografts, with relatively weak myelosuppressive effects. FK 973 is sensitive to neural tumor cells. FK 973 can be used for DNA-targeted antitumor research[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
FK 973 | FK 973 is a dihydrobenzoxazine anticancer agent. FK 973 selectively inhibits DNA synthesis and can form DNA cross-links through cytoplasmic activation. FK 973 exhibits significant antitumor activity in various animal tumor models and human tumor xenografts, with relatively weak myelosuppressive effects. FK 973 is sensitive to neural tumor cells. FK 973 can be used for DNA-targeted antitumor research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords