118-48-9
Chemical Structure
Isatoic anhydride
- CAS No.: 118-48-9
- Formula:C8H5NO3
- Molecular Weight:163.13
IUPAC Name: 2H-benzo[d][1,3]oxazine-2,4(1H)-dione
InChIKey: TXJUTRJFNRYTHH-UHFFFAOYSA-N
SMILES: O=C1OC(C2=C(N1)C=CC=C2)=O
Biological Activity: Isatoic anhydride is a single-adduct forming reagent and a monofunctional SHAPE reagent. Isatoic anhydride reacts with the 2'-hydroxyl group of RNA nucleotides via a single reactive group to form a single adduct, without forming cross-links between nucleotides. In SHAPE-JuMP experiments, Isatoic anhydride serves as a control reagent for single-adduct formation, which is used to distinguish true cross-links from single-adduct formation[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Isatoic anhydride | 99.26% | Isatoic anhydride is a single-adduct forming reagent and a monofunctional SHAPE reagent. Isatoic anhydride reacts with the 2'-hydroxyl group of RNA nucleotides via a single reactive group to form a single adduct, without forming cross-links between nucleotides. In SHAPE-JuMP experiments, Isatoic anhydride serves as a control reagent for single-adduct formation, which is used to distinguish true cross-links from single-adduct formation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
