1219795-44-4
Chemical Structure
Ethyl methanesulfonate-d5
- CAS No.: 1219795-44-4
- Formula:C3H3D5O3S
- Molecular Weight:129.19
IUPAC Name: nonanal-d18
InChIKey: PLUBXMRUUVWRLT-WNWXXORZSA-N
SMILES: [2H]C([2H])([2H])C([2H])(OS(C)(=O)=O)[2H]
Biological Activity: Ethyl methanesulfonate-d5 is the deuterium labeled Ethyl methanesulfonate[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Ethyl methanesulfonate-d5 | 99.48% | Ethyl methanesulfonate-d5 is the deuterium labeled Ethyl methanesulfonate. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Ethyl methanesulfonate | 98.24% | Ethyl methanesulfonate is an orally active biochemical agent. Ethyl methanesulfonate induces Apoptosis. Ethyl methanesulfonate acts on DNA, alkylating it and causing changes in DNA structure, which in turn triggers a series of biological effects such as mutation and cell death. Ethyl methanesulfonate induces kidney and nervous system tumors. Ethyl methanesulfonate is widely used in the field of genetic toxicology research and is often used to induce gene mutations in organisms to study gene function, the mechanism of genetic diseases, and the effects of environmental mutagenic factors, etc. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||