127685-30-7
Chemical Structure
Seproxetine hydrochloride
Synonym(s): S-Norfluoxetine hydrochloride; LY 215229 hydrochloride
- CAS No.: 127685-30-7
- Formula:C16H17ClF3NO
- Molecular Weight:331.76
IUPAC Name: (S)-3-phenyl-3-(4-(trifluoromethyl)phenoxy)propan-1-amine hydrochloride
InChIKey: GMTWWEPBGGXBTO-RSAXXLAASA-N
SMILES: NCC[C@H](OC1=CC=C(C=C1)C(F)(F)F)C2=CC=CC=C2.Cl
Biological Activity: Seproxetine (S-Norfluoxetine) hydrochloride is a selective serotonin reuptake inhibitor (SSRI) that enhances serotonin levels in the brain by specifically inhibiting the serotonin uptake carrier. Seproxetine hydrochloride exhibits strong charge transfer interactions with π-electron acceptors, forming stable complexes that enhance its binding affinity to multiple receptors, including serotonin and dopamine receptors. Seproxetine hydrochloride demonstrates improved biological activity when interacting with charge transfer complexes, leading to increased stability and efficacy in therapeutic applications.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Seproxetine hydrochloride | Seproxetine (S-Norfluoxetine) hydrochloride is a selective serotonin reuptake inhibitor (SSRI) that enhances serotonin levels in the brain by specifically inhibiting the serotonin uptake carrier. Seproxetine hydrochloride exhibits strong charge transfer interactions with π-electron acceptors, forming stable complexes that enhance its binding affinity to multiple receptors, including serotonin and dopamine receptors. Seproxetine hydrochloride demonstrates improved biological activity when interacting with charge transfer complexes, leading to increased stability and efficacy in therapeutic applications. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||