139889-62-6
Chemical Structure
D-threo-PDMP hydrochloride
- CAS No.: 139889-62-6
- Formula:C23H39ClN2O3
- Molecular Weight:427.02
IUPAC Name: N-((1R,2R)-1-hydroxy-3-morpholino-1-phenylpropan-2-yl)decanamide hydrochloride
InChIKey: HVJHJOYQTSEKPK-BLDCTAJRSA-N
SMILES: CCCCCCCCCC(N[C@H](CN1CCOCC1)[C@H](O)C2=CC=CC=C2)=O.Cl[H]
Biological Activity: D-threo-PDMP hydrochloride is a potent glucoceramide synthase (GCS) inhibitor, which reduces the glycosphingolipids (such as GM3 and GD3) on the cell surface by inhibiting glycosylation, reduces the total length of the axon plexus and the number of axon branch points, and inhibits neurite growth. D-threo-PDMP hydrochloride inhibits the synthesis of GM3, thereby reducing the adhesion ability of B16 melanoma cells and mimicking the pathological effects of hyperglycemia/TGF-β1. D-threo-PDMP hydrochloride inhibits the synthesis of GD3, thereby protecting liver cells from apoptosis induced by TNF-α. D-threo-PDMP hydrochloride can be used to study diseases related to targeted glycosphingolipid metabolism[1][2][3][4].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
D-threo-PDMP hydrochloride | 98.0% | D-threo-PDMP hydrochloride is a potent glucoceramide synthase (GCS) inhibitor, which reduces the glycosphingolipids (such as GM3 and GD3) on the cell surface by inhibiting glycosylation, reduces the total length of the axon plexus and the number of axon branch points, and inhibits neurite growth. D-threo-PDMP hydrochloride inhibits the synthesis of GM3, thereby reducing the adhesion ability of B16 melanoma cells and mimicking the pathological effects of hyperglycemia/TGF-β1. D-threo-PDMP hydrochloride inhibits the synthesis of GD3, thereby protecting liver cells from apoptosis induced by TNF-α. D-threo-PDMP hydrochloride can be used to study diseases related to targeted glycosphingolipid metabolism. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||