14021-14-8
Chemical Structure
Randialic acid B
- CAS No.: 14021-14-8
- Formula:C30H46O3
- Molecular Weight:454.68
IUPAC Name: (2R,4aS,6aS,6bR,8aR,10S,12aR,12bR)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-3,4,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13-hexadecahydropicene-4a(2H)-carboxylic acid
InChIKey: GPQBTLJRTQXVOM-UORVSENQSA-N
SMILES: OC([C@](CC[C@]12C)(CC[C@H]3C)C(C1=CC[C@@]4([H])[C@]2(CC[C@](C(C)5C)([H])[C@@]4(CC[C@@H]5O)C)C)=C3C)=O
Biological Activity: Randialic acid B, a triterpenoid compound, is a formyl peptide receptor 1 (FPR1) antagonist. Randialic acid B blocks FPR1 in human neutrophils and attenuates psoriasis-like inflammation in vivo[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Randialic acid B | 99.94% | Randialic acid B, a triterpenoid compound, is a formyl peptide receptor 1 (FPR1) antagonist. Randialic acid B blocks FPR1 in human neutrophils and attenuates psoriasis-like inflammation in vivo. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||