14154-42-8
Chemical Structure
Aluminum phthalocyanine chloride
Synonym(s): AlClPc
- CAS No.: 14154-42-8
- Formula:C32H16AlClN8
- Molecular Weight:574.96
InChIKey: LBGCRGLFTKVXDZ-UHFFFAOYSA-M
SMILES: [Cl-][Al+3]12([N](C(C3=CC=CC=C43)=N5)=C4N=C6C7=CC=CC=C87)[N-]6C8=NC9=[N]1C(C%10=CC=CC=C9%10)=NC%11=C(C=CC=C%12)C%12=C5[N-]2%11
Biological Activity: Aluminum phthalocyanine chloride is a photosensitizer that effectively inhibits the parasite Leishmania amazonensis (the causative agent of cutaneous leishmaniasis) by light-mediated cytolysis. Aluminum phthalocyanine chloride causes parasite morphology and cytolysis of isolated amasilians, while higher photosensitizer concentrations and light intensities are required to induce lysis of mammalian cells. Aluminum phthalocyanine chloride lyses parasites within infected J774 macrophages and can be used to further investigate the study of leishmaniasis[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Aluminum phthalocyanine chloride | Aluminum phthalocyanine chloride is a photosensitizer that effectively inhibits the parasite Leishmania amazonensis (the causative agent of cutaneous leishmaniasis) by light-mediated cytolysis. Aluminum phthalocyanine chloride causes parasite morphology and cytolysis of isolated amasilians, while higher photosensitizer concentrations and light intensities are required to induce lysis of mammalian cells. Aluminum phthalocyanine chloride lyses parasites within infected J774 macrophages and can be used to further investigate the study of leishmaniasis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||