143556-24-5
143556-24-5
Chemical Structure
L 012 sodium salt
- CAS No.: 143556-24-5
- Formula:C13H8ClN4NaO2
- Molecular Weight:310.67
IUPAC Name: sodium 8-amino-5-chloro-1-oxo-7-phenyl-1,2-dihydropyrido[3,4-d]pyridazin-4-olate
InChIKey: IGEUYSJHQQCEFP-UHFFFAOYSA-M
SMILES: O=C1C2=C(C(Cl)=NC(C3=CC=CC=C3)=C2N)C(O[Na])=NN1
Biological Activity: L 012 sodium salt is a luminal-based chemiluminescent probe. L 012 sodium salt can detect NADPH oxidase (Nox)-derived superoxide and nitrogen species (reactive oxygen species (ROS) and reactive nitrogen species (RNS))[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
L 012 sodium salt | 99.90% | L 012 sodium salt is a luminal-based chemiluminescent probe. L 012 sodium salt can detect NADPH oxidase (Nox)-derived superoxide and nitrogen species (reactive oxygen species (ROS) and reactive nitrogen species (RNS)). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L 012 sodium salt (Standard) | ≥98% | L 012 sodium salt (Standard) is the analytical standard of L 012 (sodium salt) (HY-108537). This product is intended for research and analytical applications. L 012 sodium salt is a luminal-based chemiluminescent probe. L 012 sodium salt can detect NADPH oxidase (Nox)-derived superoxide and nitrogen species (reactive oxygen species (ROS) and reactive nitrogen species (RNS)). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
- [1]. Zielonka J, et al. On the use of L-012, a luminol-based chemiluminescent probe, for detecting superoxide and identifying inhibitors of NADPH oxidase: a reevaluation. Free Radic Biol Med. 2013;65:1310-1314. [Content Brief]
- [2]. Kielland A, et al. In vivo imaging of reactive oxygen and nitrogen species in inflammation using the luminescent probe L-012. Free Radic Biol Med. 2009;47(6):760-766. [Content Brief]
