1619976-97-4
Chemical Structure
Eleocharin B
- CAS No.: 1619976-97-4
- Formula:C20H18O6
- Molecular Weight:354.35
InChIKey: AHGBBSURPKAPGK-HNNXBMFYSA-N
SMILES: OC1=C2C(O[C@H](C3=CC(O)=C(C=C3)O)CC2=O)=CC4=C1C=CC(C)(O4)C
Biological Activity: Eleocharin B is a prenylated flavanone antioxidant and DPPH free radical scavenger. Eleocharin B is obtained from the peel of Eleocharis tuberosa (water chestnut). Eleocharin B is used in the study of oxidative stress-related disorders[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Eleocharin B | Eleocharin B is a prenylated flavanone antioxidant and DPPH free radical scavenger. Eleocharin B is obtained from the peel of Eleocharis tuberosa (water chestnut). Eleocharin B is used in the study of oxidative stress-related disorders. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||