1636881-61-2
1636881-61-2
Chemical Structure
Mavoglurant racemate
Synonym(s): AFQ-056 racemate
- CAS No.: 1636881-61-2
- Formula:C19H23NO3
- Molecular Weight:313.39
SMILES: O=C(N1CC[C@@]2([H])[C@@](C#CC3=CC=CC(C)=C3)(O)CCC[C@@]12[H])OC
Biological Activity: Mavoglurant racemate (AFQ-056 racemate) is the racemate of Mavoglurant. Mavoglurant is a novel, non-competitive mGlu5 receptor antagonist[1]. Mavoglurant (racemate) is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Mavoglurant racemate | 98.44% | Mavoglurant racemate (AFQ-056 racemate) is the racemate of Mavoglurant. Mavoglurant is a novel, non-competitive mGlu5 receptor antagonist. Mavoglurant (racemate) is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
Keywords
