1639810-67-5
Chemical Structure
Longiferone B
- CAS No.: 1639810-67-5
- Formula:C15H22O
- Molecular Weight:218.33
IUPAC Name: (3R,3aS,8aR)-6,8a-dimethyl-3-(prop-1-en-2-yl)-2,3,3a,4,8,8a-hexahydroazulen-5(1H)-one
InChIKey: APMZPJSZMOWSFA-YDHLFZDLSA-N
SMILES: C[C@@]12[C@](CC(C(C)=CC2)=O)([H])[C@@H](CC1)C(C)=C
Biological Activity: Longiferone B is a daucane sesquiterpene, that can be isolated from Boesenbergia longiflora rhizomes. Longiferone B shows anti-inflammatory activity against NO release with an IC50 of 21.0 μM. Longiferone B also suppresses the iNOS and COX-2 mRNA expression[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Longiferone B | Longiferone B is a daucane sesquiterpene, that can be isolated from Boesenbergia longiflora rhizomes. Longiferone B shows anti-inflammatory activity against NO release with an IC50 of 21.0 μM. Longiferone B also suppresses the iNOS and COX-2 mRNA expression. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords