1715003-63-6
Chemical Structure
Malleobactin E
- CAS No.: 1715003-63-6
- Formula:C24H42N8O13
- Molecular Weight:650.64
InChIKey: DNYZQVWCBVNGDI-LTFXXXRZSA-N
SMILES: O=CN(O)CCC[C@@H](C(NCCCCN)=O)NC([C@H](CO)NC([C@@H]([C@@H](O)C(O)=O)NC([C@@H](NC=O)CCCN(O)C=O)=O)=O)=O
Biological Activity: Malleobactin E is a Burkholderia cepacia complex homologue with specific siderophore activity. Malleobactin E forms a complex with Fe3+ and promotes iron uptake by dissociating CAS-Fe3+, with a EC50 of 8.4 μM. Malleobactin E helps bacterial acquire essential iron from the environment to maintain their survival during infection[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Malleobactin E | Malleobactin E is a Burkholderia cepacia complex homologue with specific siderophore activity. Malleobactin E forms a complex with Fe3+ and promotes iron uptake by dissociating CAS-Fe3+, with a EC50 of 8.4 μM. Malleobactin E helps bacterial acquire essential iron from the environment to maintain their survival during infection. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||