1801863-88-6
Chemical Structure
TCO-PEG4-DBCO
- CAS No.: 1801863-88-6
- Formula:C38H49N3O8
- Molecular Weight:675.81
InChIKey: MXNJAXPSMJDOOY-UPHRSURJSA-N
SMILES: O=C(N1C2=CC=CC=C2C#CC3=CC=CC=C3C1)CCNC(CCOCCOCCOCCOCCNC(OC4CCC/C=C\CC4)=O)=O
Biological Activity: TCO-PEG4-DBCO is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. TCO-PEG4-DBCO is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. TCO-PEG4-DBCO is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. TCO-PEG4-DBCO also contains a TCO group that can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing Tetrazine groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
TCO-PEG4-DBCO | TCO-PEG4-DBCO is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. TCO-PEG4-DBCO is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). TCO-PEG4-DBCO is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. TCO-PEG4-DBCO also contains a TCO group that can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing Tetrazine groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
