1938081-40-3
Chemical Structure
DSPE-PEG2000-Azide ammonium
- CAS No.: 1938081-40-3
- Formula:(C2H4O)nC44H84N4O10P.NH4
- Molecular Weight:N/A
SMILES: CCCCCCCCCCCCCCCCCC(OCC(COP([O-])(OCCNC(OCCOCCN=[N+]=[N-])=O)=O)OC(CCCCCCCCCCCCCCCCC)=O)=O.[n].[NH4+]
Biological Activity: DSPE-PEG2000-Azide ammonium is an azide containing lipid that can be used to form micelles as nanoparticles for drug delivery[1]. DSPE-PEG2000-Azide ammonium is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
DSPE-PEG2000-Azide ammonium | 99.9% | DSPE-PEG2000-Azide ammonium is an azide containing lipid that can be used to form micelles as nanoparticles for drug delivery. DSPE-PEG2000-Azide ammonium is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
