1951464-78-0
Chemical Structure
c-(2'FdAMP-2'FdIMP)
- CAS No.: 1951464-78-0
- Formula:C20H21F2N9O11P2
- Molecular Weight:663.38
IUPAC Name: (2R,3R,3aR,7aR,9R,10R,10aR,14aR)-2-(6-amino-9H-purin-9-yl)-3,10-difluoro-5,12-dihydroxy-9-(6-hydroxy-9H-purin-9-yl)octahydro-2H,7H-difuro[3,2-d:3',2'-j][1,3,7,9]tetraoxa[2,8]diphosphacyclododecine 5,12-dioxide
InChIKey: SQYPPHVIIQBZKA-QPMBAPTHSA-N
SMILES: NC1=NC=NC2=C1N=CN2[C@H]3[C@H](F)[C@H](OP4(O)=O)[C@@H](COP(O)(O[C@H]5[C@@H](F)[C@H](N(C=N6)C7=C6C(O)=NC=N7)O[C@@H]5CO4)=O)O3
Biological Activity: c-(2'FdAMP-2'FdIMP) (Compound 52),a derivative of cAIMP (HY-134375), is a cyclic dinucleotide (CDN). c-(2'FdAMP-2'FdIMP) is a STING activator and significantly induce STING-dependent IRF and NF-κB pathway signaling. c-(2'FdAMP-2'FdIMP) can be used for STING-based immunotherapy, such as cancers and infectious diseases research[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
c-(2'FdAMP-2'FdIMP) | c-(2'FdAMP-2'FdIMP) (Compound 52),a derivative of cAIMP (HY-134375), is a cyclic dinucleotide (CDN). c-(2'FdAMP-2'FdIMP) is a STING activator and significantly induce STING-dependent IRF and NF-κB pathway signaling. c-(2'FdAMP-2'FdIMP) can be used for STING-based immunotherapy, such as cancers and infectious diseases research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||