202656-13-1
Chemical Structure
THAM-d11 (for molecular biology)
Synonym(s): Tris-d11 (for molecular biology);Tris(hydroxymethyl)aminomethane-d11 (for molecular biology)
- CAS No.: 202656-13-1
- Formula:C4D11NO3
- Molecular Weight:132.20
IUPAC Name: 2-(amino-d2)-2-((hydroxy-d)methyl-d2)propane-1,1,3,3-d4-1,3-diol-d2
InChIKey: LENZDBCJOHFCAS-RNVFPDRBSA-N
SMILES: [2H]OC([2H])([2H])C(C([2H])([2H])O[2H])(N([2H])[2H])C([2H])([2H])O[2H]
Biological Activity: Trometamol(Tris),for molecular biology-d11 is the deuterium labeled Trometamol(Tris),for molecular biology[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
THAM-d11 (for molecular biology) | 99.88% | Trometamol(Tris),for molecular biology-d11 is the deuterium labeled Trometamol(Tris),for molecular biology. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
THAM (Standard) | ≥98% | THAM (Standard) is the analytical standard of THAM. This product is intended for research and analytical applications. THAM (Tris) is a biologically inert amino alcohol of low toxicity, which buffers carbon dioxide and acids in vitro and in vivo. THAM is an effective amine compound for pH control in the physiological range. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
THAM | 99.88% | THAM (Tris) is a low-toxicity amino alcohol buffer, a specific CO2-consuming proton acceptor that buffers carbon dioxide and acid both in vitro and in vivo. THAM binds protons to form bicarbonate, reduces PaCO2, and induces intracellular alkalization, thereby ameliorating hypercapnia-induced elevation of pulmonary blood vessels and pulmonary arterial pressure. THAM may cause PaCO2 rebound, hypoglycemia, and respiratory depression. THAM removes amniotic epithelium and preserves the basement membrane, but depletes extracellular matrix and reduces the adhesion rate of limbal epithelial cells. THAM can act as a CO2 carrier to enhance the productivity and carbon utilization rate of Scenedesmus obliquus. THAM is a key component of buffer solutions used in various biological, cell culture, biochemical, and molecular biology applications. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||