2107273-88-9
Chemical Structure
N-(azide-PEG3)-N'-(m-PEG4)-Benzothiazole Cy5
- CAS No.: 2107273-88-9
- Formula:C39H54ClN5O7S
- Molecular Weight:772.39
IUPAC Name: 2-((1E,3E)-5-((E)-1-(2-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)ethyl)-3,3-dimethylindolin-2-ylidene)penta-1,3-dien-1-yl)-3-(2,5,8,11-tetraoxatridecan-13-yl)benzo[d]thiazol-3-ium chloride
InChIKey: MHHLVWQRJSAVFX-UHFFFAOYSA-M
SMILES: COCCOCCOCCOCC[N+]1=C(/C=C/C=C/C=C2N(CCOCCOCCOCCN=[N+]=[N-])C3=C(C=CC=C3)C/2(C)C)SC4=CC=CC=C14.[Cl-]
Biological Activity: N-(azide-PEG3)-N'-(m-PEG4)-Benzothiazole Cy5 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. N-(azide-PEG3)-N'-(m-PEG4)-Benzothiazole Cy5 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N-(azide-PEG3)-N'-(m-PEG4)-Benzothiazole Cy5 | N-(azide-PEG3)-N'-(m-PEG4)-Benzothiazole Cy5 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. N-(azide-PEG3)-N'-(m-PEG4)-Benzothiazole Cy5 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
