2365501-63-7
Chemical Structure
Clausenalansine B
- CAS No.: 2365501-63-7
- Formula:C14H13NO2
- Molecular Weight:227.26
InChIKey: GYGRDHRFWPYKTF-UHFFFAOYSA-N
SMILES: OC1=C(OC)C(NC2=C3C=CC=C2)=C3C=C1C
Biological Activity: Clausenalansine B (Compound 2) is a carbazole alkaloid found in the fruits of Clausena lansium. Clausenalansine B exhibits potent neuroprotective effects. Clausenalansine B prevents SH-SY5Y cells death from 6-OHDA (HY-B1081A) with an EC50 of 5.82 μM. Clausenalansine B can be used for the research of neurological disease, such as Parkinson’s disease[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Clausenalansine B | Clausenalansine B (Compound 2) is a carbazole alkaloid found in the fruits of Clausena lansium. Clausenalansine B exhibits potent neuroprotective effects. Clausenalansine B prevents SH-SY5Y cells death from 6-OHDA (HY-B1081A) with an EC50 of 5.82 μM. Clausenalansine B can be used for the research of neurological disease, such as Parkinson’s disease. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||