2375242-78-5
Chemical Structure
sSPhos Pd G2
- CAS No.: 2375242-78-5
- Formula:C38H44ClNNaO5PPdS
- Molecular Weight:822.66
IUPAC Name: 2-ethoxy-4-methyl-5-nitropyridine
InChIKey: MWQYWXJKMDRSJN-UHFFFAOYSA-L
SMILES: Cl[Pd]1([P](C2CCCCC2)(C3CCCCC3)C4=CC=CC=C4C5=C(OC)C=CC(S(=O)(O[Na])=O)=C5OC)C6=CC=CC=C6C7=CC=CC=C7[NH2]1
Biological Activity: sSPhos Pd G2 is a palladium catalyst with excellent cross-coupling reaction activity. sSPhos Pd G2 exhibits efficient catalytic ability in the synthesis of organic molecules and compounds. sSPhos Pd G2 can effectively promote the formation of CC bonds, optimize reaction conditions and increase yields. sSPhos Pd G2 is also used in a variety of transformation reactions, helping researchers develop new materials and compounds.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
sSPhos Pd G2 | 95.0% | sSPhos Pd G2 is a palladium catalyst with excellent cross-coupling reaction activity. sSPhos Pd G2 exhibits efficient catalytic ability in the synthesis of organic molecules and compounds. sSPhos Pd G2 can effectively promote the formation of CC bonds, optimize reaction conditions and increase yields. sSPhos Pd G2 is also used in a variety of transformation reactions, helping researchers develop new materials and compounds. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||