2381196-81-0
Chemical Structure
Boc-C1-PEG3-C4-OBn
- CAS No.: 2381196-81-0
- Formula:C23H38O6
- Molecular Weight:410.54
IUPAC Name: tert-butyl 1-phenyl-2,9,12,15-tetraoxaheptadecan-17-oate
InChIKey: RBTVTEMDPRBJLY-UHFFFAOYSA-N
SMILES: O=C(OC(C)(C)C)COCCOCCOCCCCCCOCC1=CC=CC=C1
Biological Activity: Boc-C1-PEG3-C4-OBn (PROTAC Linker 15) is a PROTAC linker, which refers to the PEG composition. Boc-C1-PEG3-C4-OBn can be used in the synthesis of a series of PROTACs, such as PROTAC SGK3 degrader-1 (HY-125878). PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Boc-C1-PEG3-C4-OBn | 95.77% | Boc-C1-PEG3-C4-OBn (PROTAC Linker 15) is a PROTAC linker, which refers to the PEG composition. Boc-C1-PEG3-C4-OBn can be used in the synthesis of a series of PROTACs, such as PROTAC SGK3 degrader-1 (HY-125878). PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||