2483829-89-4
Chemical Structure
L-Azidohomoalanine-1,2,3,4-13C4 hydrochloride
- CAS No.: 2483829-89-4
- Formula:13C4H9ClN2 15N2O2
- Molecular Weight:186.55
IUPAC Name: (S)-2-(amino-15N)-4-(azido)butanoic-1,2,3,4-13C4 acid hydrochloride
InChIKey: MHHYJRIDKLZZEO-PIUPILLASA-N
SMILES: [N-]=[N+]=[15N][13CH2][13CH2][13C@H]([15NH2])[13C](O)=O.Cl
Biological Activity: L-Azidohomoalanine-1,2,3,4-13C4 (hydrochloride) is the 13C- and 15N-labeled L-Azidohomoalanine hydrochloride. L-Azidohomoalanine hydrochloride is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. L-Azidohomoalanine-1,2,3,4-13C4 (hydrochloride) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
L-Azidohomoalanine-1,2,3,4-13C4 hydrochloride | L-Azidohomoalanine-1,2,3,4-13C4 (hydrochloride) is the 13C- and 15N-labeled L-Azidohomoalanine hydrochloride. L-Azidohomoalanine hydrochloride is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs. L-Azidohomoalanine-1,2,3,4-13C4 (hydrochloride) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Azidohomoalanine hydrochloride | 99.88% | L-Azidohomoalanine hydrochloride is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs. L-Azidohomoalanine (hydrochloride) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
