2574390-19-3
Chemical Structure
VD4162
- CAS No.: 2574390-19-3
- Formula:C41H47N9O6S
- Molecular Weight:793.93
InChIKey: AIAPZNJOJFJSQR-GZXHTMMISA-N
SMILES: O=C1[C@@H](CC2=CNC3=C2C=CC=C3)NC([C@H](CC4=CC=C(OCCCC[C@@H](C(N[C@H](C(C5=NC6=C(C=CC=C6)S5)=O)CCCNC(N)=N)=O)N1)C=C4)NC(C)=O)=O
Biological Activity: VD4162 (Compound 8b) is a macrocyclic inhibitor of serine proteases. VD4162 can significantly improve potency for all four target enzymes TMPRSS2 (IC50 = 3.7 nM), HGFA(IC50 = 3.3 nM), matriptase (IC50 = 2.9 nM), and hepsin (IC50 = 0.54 nM). VD4162 can be used for the research of cancer[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
VD4162 | VD4162 (Compound 8b) is a macrocyclic inhibitor of serine proteases. VD4162 can significantly improve potency for all four target enzymes TMPRSS2 (IC50 = 3.7 nM), HGFA(IC50 = 3.3 nM), matriptase (IC50 = 2.9 nM), and hepsin (IC50 = 0.54 nM). VD4162 can be used for the research of cancer. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||