2578876-75-0
Chemical Structure
KRAS inhibitor-10
- CAS No.: 2578876-75-0
- Formula:C30H37N3O5
- Molecular Weight:519.63
IUPAC Name: 7-(3-amino-4-methoxyphenethoxy)-N-ethyl-6-methoxy-1-(4-methoxy-2-methylphenyl)-3,4-dihydroisoquinoline-2(1H)-carboxamide
InChIKey: WKOOIGPIJNQBPY-UHFFFAOYSA-N
SMILES: O=C(N1C(C2=CC=C(OC)C=C2C)C3=C(C=C(OC)C(OCCC4=CC=C(OC)C(N)=C4)=C3)CC1)NCC
Biological Activity: KRAS inhibitor-10 selectively and effectively inhibit RAS proteins, and particularly KRAS proteins. KRAS inhibitor-10 is an orally active anti-cancer agent and can be used for cancer research, such as pancreatic cancer, breast cancer, multiple myeloma, leukemia and lung cancer. KRAS inhibitor-10 is a tetrahydroisoquinoline compound (compound 11) extracted from patent WO2021005165 A1[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
KRAS inhibitor-10 | 99.92% | KRAS inhibitor-10 selectively and effectively inhibit RAS proteins, and particularly KRAS proteins. KRAS inhibitor-10 is an orally active anti-cancer agent and can be used for cancer research, such as pancreatic cancer, breast cancer, multiple myeloma, leukemia and lung cancer. KRAS inhibitor-10 is a tetrahydroisoquinoline compound (compound 11) extracted from patent WO2021005165 A1. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||