2657720-04-0
Chemical Structure
ALK5-IN-6
- CAS No.: 2657720-04-0
- Formula:C28H36N4O5
- Molecular Weight:508.61
IUPAC Name: 4-(3-((4-((1-cyclopropyl-3-(tetrahydro-2H-pyran-4-yl)-1H-pyrazol-4-yl)oxy)-6-methoxyquinolin-7-yl)oxy)propyl)morpholine
InChIKey: KITSMQLZNHFFLK-UHFFFAOYSA-N
SMILES: COC1=CC2=C(OC3=CN(C4CC4)N=C3C5CCOCC5)C=CN=C2C=C1OCCCN6CCOCC6
Biological Activity: ALK5-IN-6 is a potent inhibitor of ALK5. Transforming growth factor beta (TGF-β) is a multifunctional cytokine that is involved in regulating cell proliferation, differentiation and apoptosis through complex receptor signaling pathways on the cell surface in an autocrine, paracrine and endocrine manner. ALK5-IN-6 has the potential for the research of TGF-β-related diseases and conditions, including but not limited to tumors, fibrotic diseases, inflammatory diseases, autoimmune diseases, etc (extracted from patent WO2021129621A1, compound 1)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
ALK5-IN-6 | ALK5-IN-6 is a potent inhibitor of ALK5. Transforming growth factor beta (TGF-β) is a multifunctional cytokine that is involved in regulating cell proliferation, differentiation and apoptosis through complex receptor signaling pathways on the cell surface in an autocrine, paracrine and endocrine manner. ALK5-IN-6 has the potential for the research of TGF-β-related diseases and conditions, including but not limited to tumors, fibrotic diseases, inflammatory diseases, autoimmune diseases, etc (extracted from patent WO2021129621A1, compound 1). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
