2687961-06-2
Chemical Structure
Allotetrahydrocortisol-d5
- CAS No.: 2687961-06-2
- Formula:C21H29D5O5
- Molecular Weight:371.52
IUPAC Name: 2-hydroxy-1-((3R,5S,8S,9S,10S,11S,13S,14S,17R)-3,11,17-trihydroxy-10,13-dimethylhexadecahydro-1H-cyclopenta[a]phenanthren-17-yl-2,2,3,4,4-d5)ethan-1-one
InChIKey: AODPIQQILQLWGS-BPZVHUKSSA-N
SMILES: C[C@@]12[C@](C(CO)=O)(O)CC[C@@]1([H])[C@]3([H])CC[C@@]4([H])C([2H])([2H])[C@@](O)([2H])C([2H])([2H])C[C@]4(C)[C@@]3([H])[C@@H](O)C2
Biological Activity: Allotetrahydrocortisol-d5 is the deuterium labeled Allotetrahydrocortisol. Allotetrahydrocortisol (5a-Tetrahydrocortisol) is a metabolite of Cortisol. Cortisol is the main glucocorticoid in human. It is produced in adrenal cortex and plays a crucial role in many physiological processes[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Allotetrahydrocortisol-d5 | Allotetrahydrocortisol-d5 is the deuterium labeled Allotetrahydrocortisol. Allotetrahydrocortisol (5a-Tetrahydrocortisol) is a metabolite of Cortisol. Cortisol is the main glucocorticoid in human. It is produced in adrenal cortex and plays a crucial role in many physiological processes. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Allotetrahydrocortisol | 99.9% | Allotetrahydrocortisol (5a-Tetrahydrocortisol) is a metabolite of Cortisol. Cortisol is the main glucocorticoid in human. It is produced in adrenal cortex and plays a crucial role in many physiological processes. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
