2857180-28-8
Chemical Structure
TrxR-IN-8
- CAS No.: 2857180-28-8
- Formula:C16H16INO2
- Molecular Weight:381.21
InChIKey: MATWSAIHYPADGV-UHFFFAOYSA-M
SMILES: COC1=CC(OC)=CC2=C1C3=C(C=[N+]2C)C=CC=C3.[I-]
Biological Activity: TrxR-IN-8 (Compound 6f) is a selective TrxR inhibitor (IC50: 10.2 μM). TrxR-IN-8 induces apoptosis through oxidative stress by stimulating the production of reactive oxygen species (ROS), reducing intracellular thiols, and lowering the glutathione/glutathione ratio. TrxR-IN-8 exhibits significant cytotoxicity against non-small cell lung cancer (NSCLC) cells[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
TrxR-IN-8 | TrxR-IN-8 (Compound 6f) is a selective TrxR inhibitor (IC50: 10.2 μM). TrxR-IN-8 induces apoptosis through oxidative stress by stimulating the production of reactive oxygen species (ROS), reducing intracellular thiols, and lowering the glutathione/glutathione ratio. TrxR-IN-8 exhibits significant cytotoxicity against non-small cell lung cancer (NSCLC) cells. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||