2879251-26-8
Chemical Structure
WIZ degrader 8
- CAS No.: 2879251-26-8
- Formula:C21H27N3O4
- Molecular Weight:385.46
InChIKey: DADIMSMRMNXYMS-HZBOCPGUSA-N
SMILES: O=C1N(C2C(NC(CC2)=O)=O)CC3=CC(O[C@H]4CN(C[C@@H](C4)C)CC)=CC=C31
Biological Activity: WIZ degrader 8 (compound 10) is a potent and selective degrader of the transcription factor WIZ, which can potently induce HbF expression. WIZ degrader 8 can lead to WIZ degradation and induce HbF expression, and has the potential to be an inhibitor of sickle cell disease[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
WIZ degrader 8 | 98.30% | WIZ degrader 8 (compound 10) is a potent and selective degrader of the transcription factor WIZ, which can potently induce HbF expression. WIZ degrader 8 can lead to WIZ degradation and induce HbF expression, and has the potential to be an inhibitor of sickle cell disease. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||