2921603-02-1
Chemical Structure
Galectin-3 antagonist 2
- CAS No.: 2921603-02-1
- Formula:C22H23NO10
- Molecular Weight:461.42
IUPAC Name: 4-(((3R,5S)-3,5-dimethylpiperidin-1-yl)sulfonyl)-N-(5-(4-(trifluoromethyl)phenyl)-1,3,4-oxadiazol-2-yl)benzamide
InChIKey: CFXAQLIZQHBOAM-NOYKIMNZSA-N
SMILES: OC[C@H]1O[C@@H](OC)[C@@H](OC(C2=C([N+]([O-])=O)C=CC=C2)=O)[C@@H](OC(C3=CC=C(C)C=C3)=O)[C@H]1O
Biological Activity: Galectin-3 is a β Galactoside specific carbohydrate recognition protein (lectin) has the ability to promote the migration of B cell precursor acute lymphoblastic leukemia (BCP-ALL) cells and withstand drug research.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Galectin-3 antagonist 2 | Galectin-3 is a β Galactoside specific carbohydrate recognition protein (lectin) has the ability to promote the migration of B cell precursor acute lymphoblastic leukemia (BCP-ALL) cells and withstand drug research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||