3030428-57-7
Chemical Structure
Claramine TFA
- CAS No.: 3030428-57-7
- Formula:C39H73F3N4O3
- Molecular Weight:703.02
InChIKey: IQNUPEHYBSIFDX-ULTNOTTESA-N
SMILES: C[C@@]12[C@]3([H])[C@](C[C@H](C1([H])C[C@H](CC2)O)NCCCNCCCCNCCCN)([H])[C@@]4([H])[C@](CC3)([C@@](CC4)([H])[C@H](C)CCCC(C)C)C.OC(C(F)(F)F)=O
Biological Activity: Claramine TFA is a steroidal polyamine. Claramine TFA can regulate the properties of lipid membranes and protect cells from various biological toxins, including misfolded protein oligomers and toxins derived from biological proteins[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Claramine TFA | 95.03% | Claramine TFA is a steroidal polyamine. Claramine TFA can regulate the properties of lipid membranes and protect cells from various biological toxins, including misfolded protein oligomers and toxins derived from biological proteins. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||