3034202-16-6
Chemical Structure
BcI-2/BcI-xI ligand 1
- CAS No.: 3034202-16-6
- Formula:C53H64ClF3N6O8S3
- Molecular Weight:1101.75
InChIKey: HEVWBISYKWQEGK-ZFESHMOZSA-N
SMILES: O=S(NC(C1=CC=C(N2[C@@](CO3)([H])CN(CC2)CC4=C(C5=CC=C(C=C5)Cl)CCC(C)(C4)C)C3=C1)=O)(C6=CC(S(C(F)(F)F)(=O)=O)=C(C=C6)N[C@@H](CSC7=CC=CC=C7)CCN8CCN(C(OC(C)(C)C)=O)CC8)=O
Biological Activity: Bcl-2/Bcl-xL ligand 1 is a Bcl-2/Bcl-xL ligand that can serve as a PROTAC target protein ligand for studies related to PROTAC synthesis, such as the synthesis of PROTAC Bcl-2/Bcl-xL Degrader-1 (HY-158551)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
BcI-2/BcI-xI ligand 1 | Bcl-2/Bcl-xL ligand 1 is a Bcl-2/Bcl-xL ligand that can serve as a PROTAC target protein ligand for studies related to PROTAC synthesis, such as the synthesis of PROTAC Bcl-2/Bcl-xL Degrader-1 (HY-158551). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||