3037776-73-8
Chemical Structure
Phe-PEG1-Dasa
- CAS No.: 3037776-73-8
- Formula:C36H44ClN9O5S
- Molecular Weight:750.31
InChIKey: VJFIUIXDGOFPOP-NDEPHWFRSA-N
SMILES: N[C@@H](CC1=CC=CC=C1)C(NCCOCCC(OCCN(CC2)CCN2C3=NC(C)=NC(NC4=NC=C(C(NC5=C(C=CC=C5Cl)C)=O)S4)=C3)=O)=O
Biological Activity: Phe-PEG1-Dasa is a BCR-ABL PROTAC degrader, with its DC50 being 1.56 nM. Phe-PEG1-Dasa uses a single amino acid (Phe) as the E3 ligand and employs the N-end rule pathway to induce the degradation of the target protein, significantly reducing the molecular size, thus being called a mini-PROTAC. Phe-PEG1-Dasa significantly inhibits the proliferation of K562 cells. Phe-PEG1-Dasa can be used for the study of leukemia[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Phe-PEG1-Dasa | Phe-PEG1-Dasa is a BCR-ABL PROTAC degrader, with its DC50 being 1.56 nM. Phe-PEG1-Dasa uses a single amino acid (Phe) as the E3 ligand and employs the N-end rule pathway to induce the degradation of the target protein, significantly reducing the molecular size, thus being called a mini-PROTAC. Phe-PEG1-Dasa significantly inhibits the proliferation of K562 cells. Phe-PEG1-Dasa can be used for the study of leukemia. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||