3048504-54-4
Chemical Structure
Antiparasitic agent-27
- CAS No.: 3048504-54-4
- Formula:C15H16N4O2
- Molecular Weight:284.31
SMILES: O=C(C1=CC=C(O)C=C1)N2CCN(C3=NC=CN=C3)CC2
Biological Activity: Antiparasitic agent-27 (Compound 2) is a potent antiparasitic agent targeting Leishmania infantum (IC50=3.1 μM). Antiparasitic agent-27 induces G0/G1 cell cycle arrest and reactive oxygen species (ROS) generation to trigger programmed cell death. Antiparasitic agent-27 is promising for research of visceral leishmaniasis (VL)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Antiparasitic agent-27 | Antiparasitic agent-27 (Compound 2) is a potent antiparasitic agent targeting Leishmania infantum (IC50=3.1 μM). Antiparasitic agent-27 induces G0/G1 cell cycle arrest and reactive oxygen species (ROS) generation to trigger programmed cell death. Antiparasitic agent-27 is promising for research of visceral leishmaniasis (VL). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||