3062270-62-3
Chemical Structure
Granzyme B contrast agent-1
- CAS No.: 3062270-62-3
- Formula:C134H170N26O34S2
- Molecular Weight:2753.07
InChIKey: HXSQBYOYMDTLHV-NGRJKJTKSA-N
SMILES: OC(CN(CCN(CCN(C1)CC(O)=O)CC(O)=O)C1CC2=CC=C(C=C2)NC(NCCCC[C@@H](C(N)=O)NC(CNC(CNC([C@H]3NC([C@@H](NC([C@@H](N(C([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](N(C([C@@H](N(C([C@@H](NC(CSC3)=O)CC4=CC=CC=C4)=O)C)CC5=CC=CC=C5)=O)C)CC6=CC=CC=C6)=O)CC7=CC=C(C=C7)O)=O)CC8=CC=C(C=C8)O)=O)CC(O)=O)=O)C(C)C)=O)CC(O)=O)=O)C(C)C)=O)CC(O)=O)=O)C(C)C)=O)CC9=CC=C(C=C9)O)=O)C)CC%10=CC=CC=C%10)=O)CC%11=CN=CN%11)=O)=O)=O)=O)=S)=O
Biological Activity: Granzyme B contrast agent-1 is a Granzyme B binder with a Kd value of 1.0 nM. When radiolabeled, Granzyme B contrast agent-1 can be used for positron emission tomography (PET) and single-photon emission computed tomography (SPECT) imaging studies of Granzyme B[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Granzyme B contrast agent-1 | Granzyme B contrast agent-1 is a Granzyme B binder with a Kd value of 1.0 nM. When radiolabeled, Granzyme B contrast agent-1 can be used for positron emission tomography (PET) and single-photon emission computed tomography (SPECT) imaging studies of Granzyme B. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
- [1]. Idriss BENNACEF, et al. Cyclic peptides as pet imaging agents of granzyme b. WO2024228936A1. WIPO (PCT). 2024-04-29.
- [2]. Hu QL, et al. Cyclic Peptides Targeting Granzyme B: Potential Applications as PET Imaging Agents. ACS medicinal chemistry letters. 2025 Feb 13;16(2):180-181. [Content Brief]