3075431-05-6
Chemical Structure
Cycloneroside B
- CAS No.: 3075431-05-6
- Formula:C23H41NO8
- Molecular Weight:459.57
SMILES: C[C@@]1([C@@]2([H])[C@@H]([C@H](CC2)CO[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)NC(C)=O)C)O[C@H](CC1)C(C)(O)C
Biological Activity: Cycloneroside B is a novel sesquiterpene aminoglycoside compound that can be isolated from Trichoderma sp. SCSIOW21. Cycloneroside B has the activity of inhibiting the production of NO, and its IC50 value for inhibiting the production of NO is 50.7 µM. Cycloneroside B can be used in the research of the anti-inflammatory field[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cycloneroside B | Cycloneroside B is a novel sesquiterpene aminoglycoside compound that can be isolated from Trichoderma sp. SCSIOW21. Cycloneroside B has the activity of inhibiting the production of NO, and its IC50 value for inhibiting the production of NO is 50.7 µM. Cycloneroside B can be used in the research of the anti-inflammatory field. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||