3075431-10-3
3075431-10-3
Chemical Structure
Harzianoside B
- CAS No.: 3075431-10-3
- Formula:C28H45NO7
- Molecular Weight:507.66
SMILES: OC/C(C[C@H](O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1NC(C)=O)/C=C(C)/CC2)=C\C[C@H]3C(C)(C)C2=C(C)CC3
Biological Activity: Harzianoside B is a diterpene aminoglycoside compound discovered from Trichoderma sp. SCSIOW21. Harzianoside B has the activity of inhibiting the production of NO. In the experiment with macrophage RAW 264.7 cells, its IC50 value is close to the maximum tested concentration of 100 µM. It can be used in the research of the anti-inflammatory field[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Harzianoside B | Harzianoside B is a diterpene aminoglycoside compound discovered from Trichoderma sp. SCSIOW21. Harzianoside B has the activity of inhibiting the production of NO. In the experiment with macrophage RAW 264.7 cells, its IC50 value is close to the maximum tested concentration of 100 µM. It can be used in the research of the anti-inflammatory field. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
Keywords
