3076960-67-0
Chemical Structure
AKT-100
- CAS No.: 3076960-67-0
- Formula:C31H32N5O3
- Molecular Weight:522.62
InChIKey: VWJSDZJYVZCRMI-BKHCZYBLSA-N
SMILES: O=C(/C(CN(C(CNC1C(C)(C)N([O])C(C)(C)C1)=O)C/2)=C/C3=CC=C(C#N)C=C3)C2=C\C4=CC=C(C#N)C=C4
Biological Activity: AKT-100 is a p53 reactivation agent. AKT-100 significantly inhibits the proliferation of various ovarian and endometrial cancer cells at low concentrations. AKT-100 can upregulate cell cycle regulatory genes (such as p21, GADD45) and pro apoptotic genes (such as NOXA, DR5), and inhibit DNA repair pathways. AKT-100 is commonly used in cancer research[1].
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
AKT-100 | AKT-100 is a p53 reactivation agent. AKT-100 significantly inhibits the proliferation of various ovarian and endometrial cancer cells at low concentrations. AKT-100 can upregulate cell cycle regulatory genes (such as p21, GADD45) and pro apoptotic genes (such as NOXA, DR5), and inhibit DNA repair pathways. AKT-100 is commonly used in cancer research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords