34212-04-9
Chemical Structure
Digitoxigenin-21,23,23-d3
Synonym(s): Cerberigenin-d3; Echujetin-d3
- CAS No.: 34212-04-9
- Formula:C23H31D3O4
- Molecular Weight:377.53
InChIKey: XZTUSOXSLKTKJQ-SHPIEWQOSA-N
SMILES: [H][C@@]12CC[C@@]3(C[C@H](CC[C@@]3([C@]1(CC[C@]4([C@@]2(CC[C@@H]4C5=C(C(OC5([2H])[2H])=O)[2H])O)C)[H])C)O)[H]
Biological Activity: Digitoxigenin-21,23,23-d3 (Cerberigenin-d3; Echujetin-d3) is the deuterium labeled Digitoxigenin (HY-B2151). Digitoxigenin is a steroid derivative commonly found in various plants, especially the foxglove plant (Digitalis purpurea). Digitoxigenin has unique chemical properties that make it an important precursor for the synthesis of cardiac glycosides, a group of drugs used to improve heart failure and certain types of arrhythmias. It works by inhibiting the sodium potassium ATPase pump, thereby increasing the force and efficiency of cardiac contractions.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Digitoxigenin-21,23,23-d3 | Digitoxigenin-21,23,23-d3 (Cerberigenin-d3; Echujetin-d3) is the deuterium labeled Digitoxigenin (HY-B2151). Digitoxigenin is a steroid derivative commonly found in various plants, especially the foxglove plant (Digitalis purpurea). Digitoxigenin has unique chemical properties that make it an important precursor for the synthesis of cardiac glycosides, a group of drugs used to improve heart failure and certain types of arrhythmias. It works by inhibiting the sodium potassium ATPase pump, thereby increasing the force and efficiency of cardiac contractions. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Digitoxigenin | 99.91% | Digitoxigenin is a biochemical reagent that can be used as a biological material or organic compound for life science related research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||