349657-39-2
![[D-Cys6,Asn7,D-Ala11,Cys14]-Bombesin (6-14) Chemical Structure](http://file.medchemexpress.cn/product_pic/hy-p11408.gif "[D-Cys6,Asn7,D-Ala11,Cys14]-Bombesin (6-14) Chemical Structure")
Chemical Structure
[D-Cys6,Asn7,D-Ala11,Cys14]-Bombesin (6-14)
- CAS No.: 349657-39-2
- Formula:C44H64N14O10S2
- Molecular Weight:1013.20
InChIKey: DJYJCZDCPJUMSK-FJNFFPSHSA-N
SMILES: O=C([C@@H](NC([C@@H](CSSC[C@H](NC([C@@H](NC([C@@H](NC([C@H](NC([C@@H](NC([C@@H](NC1=O)C)=O)C(C)C)=O)C)=O)CC2=CN=CN2)=O)CC(C)C)=O)C(N)=O)N)=O)CC(N)=O)N[C@H]1CC3=CNC4=CC=CC=C34
Biological Activity: [D-Cys6,Asn7,D-Ala11,Cys14]-Bombesin (6-14), a synthetic peptide, is a non-selective bombesin receptor agonist. [D-Cys6,Asn7,D-Ala11,Cys14]-Bombesin (6-14) has preferred pEC50 values of 8.06 for the neurotrophin B bombesin receptor (BB1), 8.69 for the gastrin-releasing peptide bombesin receptor (BB2), and 6.71 for the orphan receptor (BB3). [D-Cys6,Asn7,D-Ala11,Cys14]-Bombesin (6-14) can be used to study diseases related to bombesin receptors, such as cancer and neurological disorders[1].
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
[D-Cys6,Asn7,D-Ala11,Cys14]-Bombesin (6-14) | [D-Cys6,Asn7,D-Ala11,Cys14]-Bombesin (6-14), a synthetic peptide, is a non-selective bombesin receptor agonist. [D-Cys6,Asn7,D-Ala11,Cys14]-Bombesin (6-14) has preferred pEC50 values of 8.06 for the neurotrophin B bombesin receptor (BB1), 8.69 for the gastrin-releasing peptide bombesin receptor (BB2), and 6.71 for the orphan receptor (BB3). [D-Cys6,Asn7,D-Ala11,Cys14]-Bombesin (6-14) can be used to study diseases related to bombesin receptors, such as cancer and neurological disorders. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
