352305-38-5
Chemical Structure
Azidoethyl-SS-ethylazide
- CAS No.: 352305-38-5
- Formula:C4H8N6S2
- Molecular Weight:204.28
IUPAC Name: 1,2-bis(2-azidoethyl)disulfane
InChIKey: SYKSDZXTWAVSIP-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCSSCCN=[N+]=[N-]
Biological Activity: Azidoethyl-SS-ethylazide is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. Azidoethyl-SS-ethylazide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azidoethyl-SS-ethylazide | 98.79% | Azidoethyl-SS-ethylazide is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Azidoethyl-SS-ethylazide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
