423170-79-0
Chemical Structure
(-)-Phaselic acid
- CAS No.: 423170-79-0
- Formula:C13H12O8
- Molecular Weight:296.23
IUPAC Name: (R,E)-2-((3-(3,4-dihydroxyphenyl)acryloyl)oxy)succinic acid
InChIKey: PMKQSEYPLQIEAY-XCRNYIDWSA-N
SMILES: OC(C[C@H](C(O)=O)OC(/C=C/C1=CC(O)=C(C=C1)O)=O)=O
Biological Activity: (-)-Phaselic acid is a protein protectant that can be isolated from red clover (Trifolium pratense) leaves. (-)-Phaselic acid is synthesized through an acyl transfer reaction between caffeoyl-CoA and malic acid catalyzed by the HCT2 enzyme. As a substrate for endogenous polyphenol oxidase (PPO), its oxidation to o-quinone can inhibit protein degradation during forage storage. (-)-Phaselic acid can be used to improve the protein preservation performance of forage crops such as alfalfa, reducing nutritional losses during storage and environmental nitrogen pollution[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(-)-Phaselic acid | (-)-Phaselic acid is a protein protectant that can be isolated from red clover (Trifolium pratense) leaves. (-)-Phaselic acid is synthesized through an acyl transfer reaction between caffeoyl-CoA and malic acid catalyzed by the HCT2 enzyme. As a substrate for endogenous polyphenol oxidase (PPO), its oxidation to o-quinone can inhibit protein degradation during forage storage. (-)-Phaselic acid can be used to improve the protein preservation performance of forage crops such as alfalfa, reducing nutritional losses during storage and environmental nitrogen pollution. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||